The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(4-Fluoro-3-(3-(trifluoromethyl)phenylsulfonamido)phenoxy)benzo[d]thiazol-2-yl)cyclopropanecarboxamide ID: ALA4537807
PubChem CID: 141735071
Max Phase: Preclinical
Molecular Formula: C24H17F4N3O4S2
Molecular Weight: 551.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1nc2ccc(Oc3ccc(F)c(NS(=O)(=O)c4cccc(C(F)(F)F)c4)c3)cc2s1)C1CC1
Standard InChI: InChI=1S/C24H17F4N3O4S2/c25-18-8-6-15(11-20(18)31-37(33,34)17-3-1-2-14(10-17)24(26,27)28)35-16-7-9-19-21(12-16)36-23(29-19)30-22(32)13-4-5-13/h1-3,6-13,31H,4-5H2,(H,29,30,32)
Standard InChI Key: QDLXWRFUVOAWKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
35.5272 -1.8614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.9399 -2.5713 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.3483 -1.8589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3583 -1.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3571 -2.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0652 -2.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7748 -2.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7720 -1.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0634 -1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4832 -2.9806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.1902 -2.5709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8953 -2.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8877 -1.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1840 -1.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6010 -1.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6047 -2.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3801 -2.8140 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.8558 -2.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3742 -1.4967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6504 -1.3456 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.6491 -2.9816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6730 -2.1494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.0784 -1.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8955 -1.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6665 -0.7340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.6038 -1.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6000 -1.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2337 -2.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5270 -2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8195 -2.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8184 -3.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5308 -4.2036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2354 -3.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5330 -5.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8264 -5.4313 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.2418 -5.4274 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.5284 -5.8359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 16 1 0
15 13 1 0
13 14 2 0
14 11 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
4 20 1 0
5 21 1 0
21 2 1 0
18 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
26 24 1 0
27 26 1 0
24 27 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.54Molecular Weight (Monoisotopic): 551.0597AlogP: 6.40#Rotatable Bonds: 7Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.75CX Basic pKa: ┄CX LogP: 5.82CX LogD: 5.66Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -2.43
References 1. Zhang H, Xu L, Qin X, Chen X, Cong H, Hu L, Chen L, Miao Z, Zhang W, Cai Z, Zhuang C.. (2019) N -(7-Cyano-6-(4-fluoro-3-(2-(3-(trifluoromethyl)phenyl)acetamido)phenoxy)benzo[d ]thiazol-2-yl)cyclopropanecarboxamide (TAK-632) Analogues as Novel Necroptosis Inhibitors by Targeting Receptor-Interacting Protein Kinase 3 (RIPK3): Synthesis, Structure-Activity Relationships, and in Vivo Efficacy., 62 (14): [PMID:31095385 ] [10.1021/acs.jmedchem.9b00611 ]