N-(5-Chloro-2-methoxybenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)propionamide

ID: ALA4537830

PubChem CID: 155548448

Max Phase: Preclinical

Molecular Formula: C22H25ClN2O4S

Molecular Weight: 448.97

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OC)C(=O)CC)cc1

Standard InChI:  InChI=1S/C22H25ClN2O4S/c1-4-13-24-30(27,28)20-9-6-17(7-10-20)12-14-25(22(26)5-2)16-18-15-19(23)8-11-21(18)29-3/h1,6-11,15,24H,5,12-14,16H2,2-3H3

Standard InChI Key:  POZDIBAOOVIBRF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   23.6779   -5.3778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2734   -4.6679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.8603   -5.3752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5632   -3.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8537   -3.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1447   -3.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1440   -4.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8582   -4.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5643   -4.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4332   -3.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7210   -3.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0136   -3.0309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3015   -3.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5899   -3.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5941   -2.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8834   -1.7996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1703   -2.2077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1723   -3.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8835   -3.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8863   -4.2641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9880   -4.2596    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9896   -3.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7022   -3.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4072   -2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0153   -2.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7238   -1.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3084   -1.8036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1799   -4.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8844   -0.9824    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   19.7255   -0.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
  9  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 12 25  1  0
 25 26  1  0
 25 27  2  0
 20 28  1  0
 16 29  1  0
 26 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537830

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.97Molecular Weight (Monoisotopic): 448.1224AlogP: 3.24#Rotatable Bonds: 10
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.13CX Basic pKa: CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: -1.71

References

1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S..  (2019)  Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization.,  62  (21): [PMID:31626545] [10.1021/acs.jmedchem.9b01155]

Source