Antiquorpene A

ID: ALA4537867

PubChem CID: 155548727

Max Phase: Preclinical

Molecular Formula: C20H30O2

Molecular Weight: 302.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C[C@]23CC[C@H]1C[C@H]2[C@]1(C)CCC(=O)[C@@](C)(CO)[C@H]1CC3

Standard InChI:  InChI=1S/C20H30O2/c1-13-11-20-8-4-14(13)10-16(20)18(2)7-6-17(22)19(3,12-21)15(18)5-9-20/h14-16,21H,1,4-12H2,2-3H3/t14-,15-,16-,18+,19-,20+/m0/s1

Standard InChI Key:  GCCMUSBQGKNMLC-BRMIGGSTSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    3.9818   -6.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5758   -6.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1609   -6.7905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8633   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8633   -5.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5797   -4.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2918   -4.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2929   -5.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0039   -6.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7186   -5.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0017   -4.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7171   -4.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4334   -4.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4407   -3.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7254   -3.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0025   -3.6056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1325   -2.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1238   -4.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1492   -6.0861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2884   -6.4953    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5692   -7.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2840   -4.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9967   -5.2557    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3033   -2.4746    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3429   -1.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
  4  5  1  0
  4  6  1  0
  5  2  1  0
  2  8  1  0
  7  6  1  0
  7  8  1  0
  7 11  1  0
  8  9  1  0
  9 10  1  0
 10 12  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 12 18  1  1
 17 18  1  0
  5 19  2  0
  8 20  1  1
  1 21  1  0
  7 22  1  6
 11 23  1  1
 15 24  1  6
 17 25  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4537867

    ---

Associated Targets(non-human)

BV-2 (3710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 302.46Molecular Weight (Monoisotopic): 302.2246AlogP: 4.13#Rotatable Bonds: 1
Polar Surface Area: 37.30Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.67CX LogD: 3.67
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.74Np Likeness Score: 3.44

References

1. Liang Y, An L, Shi Z, Zhang X, Xie C, Tuerhong M, Song Z, Ohizumi Y, Lee D, Shuai L, Xu J, Guo Y..  (2019)  Bioactive Diterpenoids from the Stems of Euphorbia antiquorum.,  82  (6): [PMID:31180680] [10.1021/acs.jnatprod.9b00134]

Source