3-cyclohexyl-N-(cyclopropylsulfonyl)-1-methyl-2-(2-morpholinopyrimidin-5-yl)-1H-indole-6-carboxamide

ID: ALA4537869

PubChem CID: 155548729

Max Phase: Preclinical

Molecular Formula: C27H33N5O4S

Molecular Weight: 523.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1c(-c2cnc(N3CCOCC3)nc2)c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)C3CC3)cc21

Standard InChI:  InChI=1S/C27H33N5O4S/c1-31-23-15-19(26(33)30-37(34,35)21-8-9-21)7-10-22(23)24(18-5-3-2-4-6-18)25(31)20-16-28-27(29-17-20)32-11-13-36-14-12-32/h7,10,15-18,21H,2-6,8-9,11-14H2,1H3,(H,30,33)

Standard InChI Key:  SNJXDEQKKQKJQY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   23.2228   -9.4008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.6395  -10.1175    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.0519   -9.3982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7848  -11.7829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5013  -11.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4985  -10.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7831  -10.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0699  -11.3700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0712  -10.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2875  -10.2896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8018  -10.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2856  -11.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0338   -9.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0315  -12.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2229  -12.5729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9661  -13.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5142  -13.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3229  -13.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5833  -13.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2114  -10.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9275  -10.5335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2084   -9.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3566  -10.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7738  -11.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1836  -10.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9802  -10.9571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5693  -10.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7450  -10.2388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3305  -10.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7465  -11.6707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5695  -11.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5056  -10.9532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0955  -10.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2741  -10.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8576  -10.9494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2689  -11.6658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0965  -11.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 10 13  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 12 14  1  0
  6 20  1  0
 20 21  1  0
 20 22  2  0
 21  2  1  0
  2 23  1  0
 24 23  1  0
 25 24  1  0
 23 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 11 26  1  0
 29 32  1  0
 32 33  1  0
 32 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537869

    ---

Associated Targets(Human)

SCN9A Tclin Sodium channel protein type IX alpha subunit (8393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.66Molecular Weight (Monoisotopic): 523.2253AlogP: 3.74#Rotatable Bonds: 6
Polar Surface Area: 106.42Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.08CX Basic pKa: 2.48CX LogP: 3.58CX LogD: 2.79
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -1.03

References

1. Wu YJ, Venables B, Guernon J, Chen J, Sit SY, Rajamani R, Knox RJ, Matchett M, Pieschl RL, Herrington J, Bristow LJ, Meanwell NA, Thompson LA, Dzierba C..  (2019)  Discovery of new indole-based acylsulfonamide Nav1.7 inhibitors.,  29  (4): [PMID:30638874] [10.1016/j.bmcl.2018.12.013]

Source