N-(2-((4-(Pyridin-3-yl)phenethyl)amino)ethyl)isoquinoline-5-sulfonamide

ID: ALA4537870

PubChem CID: 155548730

Max Phase: Preclinical

Molecular Formula: C24H24N4O2S

Molecular Weight: 432.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(NCCNCCc1ccc(-c2cccnc2)cc1)c1cccc2cnccc12

Standard InChI:  InChI=1S/C24H24N4O2S/c29-31(30,24-5-1-3-22-18-27-14-11-23(22)24)28-16-15-25-13-10-19-6-8-20(9-7-19)21-4-2-12-26-17-21/h1-9,11-12,14,17-18,25,28H,10,13,15-16H2

Standard InChI Key:  WSIKRQWUOAHLHX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   18.4033   -5.2663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9988   -4.5606    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.5899   -5.2637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4145   -4.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1222   -4.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8299   -4.5606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7068   -4.1520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2914   -4.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8809   -3.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8836   -4.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5910   -4.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5896   -2.9252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2949   -3.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0003   -2.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0016   -2.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2916   -1.7058    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5892   -2.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5376   -4.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2453   -4.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9530   -4.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6595   -4.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3668   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3672   -3.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6545   -2.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9502   -3.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0702   -2.9302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7788   -3.3396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4854   -2.9307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4848   -2.1127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7716   -1.7052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0678   -2.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  7  2  1  0
  2  8  1  0
  8 13  2  0
 12  9  2  0
  9 10  1  0
 10 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  6 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537870

    ---

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.55Molecular Weight (Monoisotopic): 432.1620AlogP: 3.41#Rotatable Bonds: 9
Polar Surface Area: 83.98Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.06CX Basic pKa: 8.80CX LogP: 2.40CX LogD: 1.22
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -1.14

References

1. Grimm SH, Gagestein B, Keijzer JF, Liu N, Wijdeven RH, Lenselink EB, Tuin AW, van den Nieuwendijk AMCH, van Westen GJP, van Boeckel CAA, Overkleeft HS, Neefjes J, van der Stelt M..  (2019)  Comprehensive structure-activity-relationship of azaindoles as highly potent FLT3 inhibitors.,  27  (5): [PMID:30661740] [10.1016/j.bmc.2019.01.006]

Source