The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-9-Isopropyl-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diyl diacetate ID: ALA4537900
PubChem CID: 146025822
Max Phase: Preclinical
Molecular Formula: C24H27NO4
Molecular Weight: 393.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Oc1c(C(C)C)cc2c(c1OC(C)=O)-c1cccc3c1[C@@H](C2)N(C)CC3
Standard InChI: InChI=1S/C24H27NO4/c1-13(2)19-11-17-12-20-21-16(9-10-25(20)5)7-6-8-18(21)22(17)24(29-15(4)27)23(19)28-14(3)26/h6-8,11,13,20H,9-10,12H2,1-5H3/t20-/m1/s1
Standard InChI Key: KFEHEEITVOEJOF-HXUWFJFHSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
26.0341 -6.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7435 -5.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7435 -5.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0341 -4.6101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0293 -3.7934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3247 -5.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3272 -5.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6193 -4.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9085 -5.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9099 -5.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6183 -6.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6074 -3.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3177 -3.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3148 -2.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6024 -2.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8913 -2.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8977 -3.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4528 -4.6211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1802 -2.1778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1932 -3.8121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7362 -4.1974 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.5981 -1.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3036 -0.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8882 -0.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1997 -4.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4760 -2.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7649 -2.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4828 -3.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4953 -5.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6036 -5.3324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
7 4 1 0
4 5 1 0
5 13 1 0
12 8 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
3 18 1 0
16 19 1 0
17 20 1 0
4 21 1 6
15 22 1 0
22 23 1 0
22 24 1 0
20 25 1 0
19 26 1 0
26 27 1 0
26 28 2 0
25 29 1 0
25 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.48Molecular Weight (Monoisotopic): 393.1940AlogP: 4.41#Rotatable Bonds: 3Polar Surface Area: 55.84Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.54CX LogP: 4.16CX LogD: 3.78Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.57Np Likeness Score: 1.18
References 1. Park H, Urs AN, Zimmerman J, Liu C, Wang Q, Urs NM.. (2020) Structure-Functional-Selectivity Relationship Studies of Novel Apomorphine Analogs to Develop D1R/D2R Biased Ligands., 11 (3): [PMID:32184974 ] [10.1021/acsmedchemlett.9b00575 ]