2,2'-(5,5'-methylenebis(benzofuran-5,2-diyl))bis(3-ethyl-1,3-thiazinan-4-one)

ID: ALA4537903

PubChem CID: 155549023

Max Phase: Preclinical

Molecular Formula: C29H30N2O4S2

Molecular Weight: 534.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1C(=O)CCSC1c1cc2cc(Cc3ccc4oc(C5SCCC(=O)N5CC)cc4c3)ccc2o1

Standard InChI:  InChI=1S/C29H30N2O4S2/c1-3-30-26(32)9-11-36-28(30)24-16-20-14-18(5-7-22(20)34-24)13-19-6-8-23-21(15-19)17-25(35-23)29-31(4-2)27(33)10-12-37-29/h5-8,14-17,28-29H,3-4,9-13H2,1-2H3

Standard InChI Key:  JCBLJPFEMPIWEP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   35.8942  -29.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6039  -29.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6011  -28.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8924  -27.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1862  -29.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1829  -28.3405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4053  -28.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9280  -28.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4107  -29.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.3072  -27.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0165  -28.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0162  -29.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7246  -29.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7171  -27.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4260  -28.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4360  -29.1376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2200  -29.3819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6946  -28.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2039  -28.0534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1144  -28.7587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7042  -28.0508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8905  -28.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4810  -28.7598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8913  -29.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7111  -29.4679    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.5111  -28.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9270  -29.4053    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.7406  -29.3974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1444  -28.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7285  -27.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9087  -27.9884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4817  -27.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1308  -27.2708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4922  -27.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8929  -26.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1116  -27.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7018  -26.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 16  2  0
 15 14  2  0
 14 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  8 20  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 18 26  1  0
 22 32  2  0
 30 33  2  0
 31 34  1  0
 34 35  1  0
 21 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4537903

    ---

Associated Targets(non-human)

Chikungunya virus (1339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.70Molecular Weight (Monoisotopic): 534.1647AlogP: 6.74#Rotatable Bonds: 6
Polar Surface Area: 66.90Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 4.92CX LogD: 4.92
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.15

References

1. Hwu JR, Huang WC, Lin SY, Tan KT, Hu YC, Shieh FK, Bachurin SO, Ustyugov A, Tsay SC..  (2019)  Chikungunya virus inhibition by synthetic coumarin-guanosine conjugates.,  166  [PMID:30703657] [10.1016/j.ejmech.2019.01.037]

Source