The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2'-(5,5'-methylenebis(benzofuran-5,2-diyl))bis(3-ethyl-1,3-thiazinan-4-one) ID: ALA4537903
PubChem CID: 155549023
Max Phase: Preclinical
Molecular Formula: C29H30N2O4S2
Molecular Weight: 534.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1C(=O)CCSC1c1cc2cc(Cc3ccc4oc(C5SCCC(=O)N5CC)cc4c3)ccc2o1
Standard InChI: InChI=1S/C29H30N2O4S2/c1-3-30-26(32)9-11-36-28(30)24-16-20-14-18(5-7-22(20)34-24)13-19-6-8-23-21(15-19)17-25(35-23)29-31(4-2)27(33)10-12-37-29/h5-8,14-17,28-29H,3-4,9-13H2,1-2H3
Standard InChI Key: JCBLJPFEMPIWEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
35.8942 -29.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6039 -29.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6011 -28.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8924 -27.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1862 -29.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1829 -28.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4053 -28.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9280 -28.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4107 -29.4124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3072 -27.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0165 -28.3286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0162 -29.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7246 -29.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7171 -27.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4260 -28.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4360 -29.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2200 -29.3819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6946 -28.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2039 -28.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1144 -28.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7042 -28.0508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8905 -28.0522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4810 -28.7598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8913 -29.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7111 -29.4679 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.5111 -28.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9270 -29.4053 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.7406 -29.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1444 -28.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7285 -27.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9087 -27.9884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4817 -27.3446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1308 -27.2708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.4922 -27.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8929 -26.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1116 -27.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7018 -26.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
3 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 16 2 0
15 14 2 0
14 11 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
8 20 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
18 26 1 0
22 32 2 0
30 33 2 0
31 34 1 0
34 35 1 0
21 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.70Molecular Weight (Monoisotopic): 534.1647AlogP: 6.74#Rotatable Bonds: 6Polar Surface Area: 66.90Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.15
References 1. Hwu JR, Huang WC, Lin SY, Tan KT, Hu YC, Shieh FK, Bachurin SO, Ustyugov A, Tsay SC.. (2019) Chikungunya virus inhibition by synthetic coumarin-guanosine conjugates., 166 [PMID:30703657 ] [10.1016/j.ejmech.2019.01.037 ]