The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Cyclohexyl-N-(1-isopropylpiperidin-4-yl)-8-methoxy-7-(3-(pyrrolidin-1-yl)propoxy)-3H-benzo[b][1,4]diazepin-2-amine ID: ALA4537940
PubChem CID: 155549294
Max Phase: Preclinical
Molecular Formula: C31H49N5O2
Molecular Weight: 523.77
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OCCCN1CCCC1)N=C(C1CCCCC1)CC(NC1CCN(C(C)C)CC1)=N2
Standard InChI: InChI=1S/C31H49N5O2/c1-23(2)36-17-12-25(13-18-36)32-31-22-26(24-10-5-4-6-11-24)33-27-21-30(29(37-3)20-28(27)34-31)38-19-9-16-35-14-7-8-15-35/h20-21,23-25H,4-19,22H2,1-3H3,(H,32,34)
Standard InChI Key: FPPVMKMKEYUJIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
30.9941 -23.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9929 -24.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7010 -24.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6992 -23.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2849 -24.7899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5775 -24.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2863 -23.1539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2861 -22.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8695 -24.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1621 -24.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4541 -24.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7101 -24.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1628 -25.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5709 -25.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3703 -25.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4086 -24.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4039 -23.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0422 -23.0424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0557 -24.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8431 -23.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8552 -24.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2028 -23.9506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3714 -25.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0761 -26.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5886 -26.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3964 -26.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6890 -25.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1739 -25.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3467 -22.5708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0411 -21.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5497 -21.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2473 -20.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4384 -20.2990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9327 -20.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2359 -21.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1357 -19.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6417 -18.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3270 -19.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 16 2 0
17 4 2 0
4 1 1 0
2 5 1 0
5 6 1 0
1 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
16 17 1 0
17 18 1 0
16 19 1 0
18 20 2 0
19 21 2 0
20 22 1 0
21 22 1 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 1 0
36 37 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.77Molecular Weight (Monoisotopic): 523.3886AlogP: 6.11#Rotatable Bonds: 9Polar Surface Area: 61.69Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.57CX LogP: 4.86CX LogD: 1.13Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.40Np Likeness Score: -0.83
References 1. Milite C, Feoli A, Horton JR, Rescigno D, Cipriano A, Pisapia V, Viviano M, Pepe G, Amendola G, Novellino E, Cosconati S, Cheng X, Castellano S, Sbardella G.. (2019) Discovery of a Novel Chemotype of Histone Lysine Methyltransferase EHMT1/2 (GLP/G9a) Inhibitors: Rational Design, Synthesis, Biological Evaluation, and Co-crystal Structure., 62 (5): [PMID:30753076 ] [10.1021/acs.jmedchem.8b02008 ]