The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Chloro-4-(4-decylpiperazine-1-carboxamido)phenyl sulfamate ID: ALA4538006
PubChem CID: 155548974
Max Phase: Preclinical
Molecular Formula: C21H35ClN4O4S
Molecular Weight: 475.06
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCN1CCN(C(=O)Nc2ccc(OS(N)(=O)=O)c(Cl)c2)CC1
Standard InChI: InChI=1S/C21H35ClN4O4S/c1-2-3-4-5-6-7-8-9-12-25-13-15-26(16-14-25)21(27)24-18-10-11-20(19(22)17-18)30-31(23,28)29/h10-11,17H,2-9,12-16H2,1H3,(H,24,27)(H2,23,28,29)
Standard InChI Key: PRUCHMHXUAQFSX-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
37.7889 -9.1005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3844 -8.3948 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.9755 -9.0979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5559 -8.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5547 -9.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2628 -9.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9724 -9.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9696 -8.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2610 -7.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8467 -9.6347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1393 -9.2255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4313 -9.6336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1400 -8.4084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7266 -9.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0207 -9.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0159 -10.4412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7231 -10.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4352 -10.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6758 -7.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0912 -7.9869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3063 -10.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2585 -7.1811 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.3026 -11.6638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0084 -12.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7180 -11.6702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4238 -12.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1334 -11.6767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8392 -12.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5488 -11.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2546 -12.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9642 -11.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
12 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
8 19 1 0
19 2 1 0
2 20 1 0
16 21 1 0
9 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.06Molecular Weight (Monoisotopic): 474.2068AlogP: 4.21#Rotatable Bonds: 12Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.24CX Basic pKa: 7.62CX LogP: 4.41CX LogD: 3.99Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.45
References 1. Moi D, Foster PA, Rimmer LG, Jaffri A, Deplano A, Balboni G, Onnis V, Potter BVL.. (2019) Synthesis and in vitro evaluation of piperazinyl-ureido sulfamates as steroid sulfatase inhibitors., 182 [PMID:31422224 ] [10.1016/j.ejmech.2019.111614 ]