3-(4-(3-methoxybenzyl)piperazin-1-yl)-N-(4-phenylthiazol-2-yl)propanamide

ID: ALA4538035

PubChem CID: 155549075

Max Phase: Preclinical

Molecular Formula: C24H28N4O2S

Molecular Weight: 436.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(CN2CCN(CCC(=O)Nc3nc(-c4ccccc4)cs3)CC2)c1

Standard InChI:  InChI=1S/C24H28N4O2S/c1-30-21-9-5-6-19(16-21)17-28-14-12-27(13-15-28)11-10-23(29)26-24-25-22(18-31-24)20-7-3-2-4-8-20/h2-9,16,18H,10-15,17H2,1H3,(H,25,26,29)

Standard InChI Key:  NQIYTIGETFUWID-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   23.4861   -4.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3111   -4.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7234   -3.3476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3111   -2.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4861   -2.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0734   -3.3476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5485   -3.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9598   -2.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7842   -2.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1997   -1.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7860   -1.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9568   -1.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5492   -1.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2484   -3.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8347   -4.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0097   -4.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6003   -4.7811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5983   -3.3510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7753   -4.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2883   -4.1196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5038   -4.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5050   -5.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2902   -5.4560    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8355   -3.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9258   -3.0753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2577   -2.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5031   -2.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4206   -3.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0855   -4.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0247   -1.9248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4338   -2.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  3  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  6 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
 10 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538035

    ---

Associated Targets(non-human)

Peritoneal macrophage (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.58Molecular Weight (Monoisotopic): 436.1933AlogP: 3.97#Rotatable Bonds: 8
Polar Surface Area: 57.70Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.10CX Basic pKa: 7.38CX LogP: 3.70CX LogD: 3.66
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -2.00

References

1. Chen L, Chen H, Chen P, Zhang W, Wu C, Sun C, Luo W, Zheng L, Liu Z, Liang G..  (2019)  Development of 2-amino-4-phenylthiazole analogues to disrupt myeloid differentiation factor 88 and prevent inflammatory responses in acute lung injury.,  161  [PMID:30342423] [10.1016/j.ejmech.2018.09.068]

Source