3-amino-6-methyl-N-[2-[4-(10-oxa-3,7-diazaspiro[4.5]decan-3-yl)phenyl]ethyl]thieno[2,3-b]pyridine-2-carboxamide

ID: ALA4538094

PubChem CID: 153311010

Max Phase: Preclinical

Molecular Formula: C24H29N5O2S

Molecular Weight: 451.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCC5(CNCCO5)C4)cc3)sc2n1

Standard InChI:  InChI=1S/C24H29N5O2S/c1-16-2-7-19-20(25)21(32-23(19)28-16)22(30)27-10-8-17-3-5-18(6-4-17)29-12-9-24(15-29)14-26-11-13-31-24/h2-7,26H,8-15,25H2,1H3,(H,27,30)

Standard InChI Key:  YFNCJZDINCZFFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   11.4489  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2661  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6725  -11.3023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2661  -10.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4489  -10.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0381  -11.3023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1882  -12.4395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7774  -10.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7763  -11.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4843  -11.8850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4825  -10.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1911  -10.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1964  -11.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9808  -11.7255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592  -11.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9723  -10.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2197   -9.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2764  -11.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6895  -11.7578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6804  -10.3434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5067  -11.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9199  -12.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7370  -12.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1440  -13.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9602  -13.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3653  -12.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9468  -11.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1322  -11.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0682  -11.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6823  -13.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4619  -12.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6660  -11.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 12  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26  7  1  0
  9 29  1  0
  7 30  1  0
 30 31  1  0
 31  1  1  0
  1 32  1  0
 32  7  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538094

    ---

Associated Targets(Human)

USP28 Tchem Ubiquitin carboxyl-terminal hydrolase 28 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
USP25 Tchem Ubiquitin carboxyl-terminal hydrolase 25 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.60Molecular Weight (Monoisotopic): 451.2042AlogP: 2.73#Rotatable Bonds: 5
Polar Surface Area: 92.51Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.46CX LogP: 2.57CX LogD: 1.47
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.19

References

1.  (2017)  Thienopyridine carboxamides as ubiquitin-specific protease inhibitors, 

Source