The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(3-(4-Chlorophenoxy)propyl)-8-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole 2,2,2-trifluoroacetate ID: ALA4538113
PubChem CID: 155549510
Max Phase: Preclinical
Molecular Formula: C23H24ClF3N2O4
Molecular Weight: 370.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2c3c(n(CCCOc4ccc(Cl)cc4)c12)CNCC3.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C21H23ClN2O2.C2HF3O2/c1-25-20-5-2-4-18-17-10-11-23-14-19(17)24(21(18)20)12-3-13-26-16-8-6-15(22)7-9-16;3-2(4,5)1(6)7/h2,4-9,23H,3,10-14H2,1H3;(H,6,7)
Standard InChI Key: GCRUPJOIKBOYRM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
19.4706 -5.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1783 -5.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8860 -5.6007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1783 -4.3749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7382 -6.0315 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.6723 -5.2972 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4451 -6.4715 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.0664 -4.3041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6539 -5.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4017 -4.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5991 -4.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0478 -5.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3048 -6.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1068 -6.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7357 -4.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4732 -5.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0204 -6.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8331 -6.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0957 -5.2446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5455 -4.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0647 -3.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7782 -3.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7765 -2.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4901 -1.8261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2054 -2.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2029 -3.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9175 -3.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6320 -3.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6276 -2.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9125 -1.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3479 -3.4704 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3453 -3.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5386 -3.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 16 1 0
15 8 1 0
8 10 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
11 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.88Molecular Weight (Monoisotopic): 370.1448AlogP: 4.42#Rotatable Bonds: 6Polar Surface Area: 35.42Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.07CX LogP: 3.96CX LogD: 2.30Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: -0.64
References 1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C.. (2019) Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis., 62 (5): [PMID:30753074 ] [10.1021/acs.jmedchem.8b01598 ]