9-(3-(4-Chlorophenoxy)propyl)-8-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole 2,2,2-trifluoroacetate

ID: ALA4538113

PubChem CID: 155549510

Max Phase: Preclinical

Molecular Formula: C23H24ClF3N2O4

Molecular Weight: 370.88

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc2c3c(n(CCCOc4ccc(Cl)cc4)c12)CNCC3.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C21H23ClN2O2.C2HF3O2/c1-25-20-5-2-4-18-17-10-11-23-14-19(17)24(21(18)20)12-3-13-26-16-8-6-15(22)7-9-16;3-2(4,5)1(6)7/h2,4-9,23H,3,10-14H2,1H3;(H,6,7)

Standard InChI Key:  GCRUPJOIKBOYRM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   19.4706   -5.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1783   -5.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8860   -5.6007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1783   -4.3749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7382   -6.0315    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.6723   -5.2972    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.4451   -6.4715    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.0664   -4.3041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6539   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4017   -4.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5991   -4.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0478   -5.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3048   -6.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1068   -6.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7357   -4.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4732   -5.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0204   -6.1953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8331   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0957   -5.2446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5455   -4.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0647   -3.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7782   -3.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7765   -2.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4901   -1.8261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2054   -2.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2029   -3.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9175   -3.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6320   -3.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6276   -2.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9125   -1.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3479   -3.4704    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.3453   -3.8351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5386   -3.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9 16  1  0
 15  8  1  0
  8 10  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  8 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 11 32  1  0
 32 33  1  0
M  END

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 370.88Molecular Weight (Monoisotopic): 370.1448AlogP: 4.42#Rotatable Bonds: 6
Polar Surface Area: 35.42Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.07CX LogP: 3.96CX LogD: 2.30
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.65Np Likeness Score: -0.64

References

1. Tu J, Li Z, Jiang Y, Ji C, Han G, Wang Y, Liu N, Sheng C..  (2019)  Discovery of Carboline Derivatives as Potent Antifungal Agents for the Treatment of Cryptococcal Meningitis.,  62  (5): [PMID:30753074] [10.1021/acs.jmedchem.8b01598]

Source