3-(1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)cyclopropanecarboxamido)-4-methyl-N-phenylbenzamide

ID: ALA4538140

PubChem CID: 155548916

Max Phase: Preclinical

Molecular Formula: C24H21N5O2

Molecular Weight: 411.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)C1(c2ncnc3[nH]ccc23)CC1

Standard InChI:  InChI=1S/C24H21N5O2/c1-15-7-8-16(22(30)28-17-5-3-2-4-6-17)13-19(15)29-23(31)24(10-11-24)20-18-9-12-25-21(18)27-14-26-20/h2-9,12-14H,10-11H2,1H3,(H,28,30)(H,29,31)(H,25,26,27)

Standard InChI Key:  SHIWIQYWTPQUEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    1.8119   -9.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6290   -9.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2204   -8.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9301  -10.8422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9290  -11.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6370  -12.0707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6352  -10.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3439  -10.8386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3441  -11.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1228  -11.9100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6038  -11.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1223  -10.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3393   -9.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3420   -8.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0456   -9.6164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7547   -9.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4585   -9.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1671   -9.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1703   -8.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4589   -7.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7533   -8.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0451   -7.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8732   -9.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8701  -10.4460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5825   -9.2229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2886   -9.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2816  -10.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9869  -10.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6971  -10.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6977   -9.6351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9918   -9.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
  7  2  1  0
  2 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 18 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538140

    ---

Associated Targets(Human)

BRAF Tclin Serine/threonine-protein kinase B-raf (11587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.47Molecular Weight (Monoisotopic): 411.1695AlogP: 4.19#Rotatable Bonds: 5
Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.29CX Basic pKa: 4.14CX LogP: 4.21CX LogD: 4.21
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.46Np Likeness Score: -1.27

References

1. Wang L, Zhang Y, Zhang Q, Zhu G, Zhang Z, Duan C, Lu T, Tang W..  (2019)  Discovery of potent Pan-Raf inhibitors with increased solubility to overcome drug resistance.,  163  [PMID:30529543] [10.1016/j.ejmech.2018.11.033]

Source