1-(4-((5-chloro-4-((1-methyl-1H-indazol-5-yl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea

ID: ALA4538143

PubChem CID: 155548978

Max Phase: Preclinical

Molecular Formula: C26H24ClN9O2

Molecular Weight: 529.99

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)NCc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2ccc3c(cnn3C)c2)n1

Standard InChI:  InChI=1S/C26H24ClN9O2/c1-36-22-8-6-18(10-17(22)14-31-36)32-24-20(27)15-29-25(35-24)34-21-7-5-19(11-23(21)38-2)33-26(37)30-13-16-4-3-9-28-12-16/h3-12,14-15H,13H2,1-2H3,(H2,30,33,37)(H2,29,32,34,35)

Standard InChI Key:  MLLMJKODSGXPRZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   33.1237  -10.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1226  -11.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8306  -12.1285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5403  -11.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5375  -10.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8288  -10.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2436  -10.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9529  -10.8910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6590  -10.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3683  -10.8857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0744  -10.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7797  -10.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4854  -10.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4827   -9.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7685   -9.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0657   -9.6607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6559   -9.6626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1944  -10.8778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1971  -11.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1883   -9.2413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8981   -9.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8981  -10.4636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.6071  -10.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3137  -10.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3069   -9.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5973   -9.2337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.0240  -10.8603    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   43.0110   -9.2202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.7222   -9.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7240  -10.4388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4344  -10.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4189   -9.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1309   -9.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1407  -10.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9278  -10.6719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.4044   -9.9992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.9119   -9.3381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1895  -11.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  2  0
 13 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 34  2  0
 33 32  2  0
 32 29  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 33  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538143

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.99Molecular Weight (Monoisotopic): 529.1741AlogP: 5.23#Rotatable Bonds: 8
Polar Surface Area: 130.91Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.74CX Basic pKa: 4.82CX LogP: 3.73CX LogD: 3.73
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -1.95

References

1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y..  (2019)  Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors.,  178  [PMID:31177074] [10.1016/j.ejmech.2019.05.060]

Source