12beta-O-[deca-2Z,4E-dienoyl]-13alpha-isobutyryl-5-ene-7-oxo-4beta-phorbol

ID: ALA4538168

PubChem CID: 155549089

Max Phase: Preclinical

Molecular Formula: C34H46O9

Molecular Weight: 598.73

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCC/C=C/C=C\C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C(=O)C(CO)=C[C@]3(O)C(=O)C(C)=C[C@@H]23)[C@@H]2C(C)(C)[C@]12OC(=O)C(C)C

Standard InChI:  InChI=1S/C34H46O9/c1-8-9-10-11-12-13-14-15-24(36)42-29-21(5)33(41)23-16-20(4)28(38)32(23,40)17-22(18-35)26(37)25(33)27-31(6,7)34(27,29)43-30(39)19(2)3/h12-17,19,21,23,25,27,29,35,40-41H,8-11,18H2,1-7H3/b13-12+,15-14-/t21-,23-,25+,27-,29-,32-,33+,34-/m1/s1

Standard InChI Key:  GOFSCWBZJWJLTF-GKOQXERBSA-N

Molfile:  

 
     RDKit          2D

 46 49  0  0  0  0  0  0  0  0999 V2000
   38.4917   -6.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7755   -6.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4796   -7.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2318   -7.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5901   -7.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8733   -8.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6903   -8.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9114   -7.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1701   -9.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9886   -9.2906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5271   -8.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4207   -9.3028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8035   -7.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3092  -10.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1205  -10.1405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.4572   -9.3693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6624   -7.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3859   -7.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3312   -6.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6320   -6.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1308   -7.0121    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.0833   -8.2865    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.9109   -6.2798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3055   -5.4150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0546   -6.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0825   -7.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6445   -8.0227    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.6377   -6.0453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4325   -8.2627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6321   -5.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3369   -4.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0475   -5.2153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9216   -4.8214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3313   -3.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5854   -5.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5597   -4.2120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8908   -5.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1706   -5.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1450   -4.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4248   -3.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3992   -3.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6790   -2.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6534   -1.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9332   -1.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9076   -0.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3143   -8.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8 17  1  0
  7  9  1  0
  9 10  2  0
 18 11  1  0
 10 11  1  0
  6 12  2  0
  5 13  1  0
 10 14  1  0
 14 15  1  0
  7 16  1  1
 17 18  1  0
 17 20  1  0
 18 26  1  0
 25 19  1  0
 19 20  1  0
  8 21  1  6
 18 22  1  1
 20 23  1  6
 19 24  1  1
 26 25  1  0
  2 26  1  0
 25  2  1  0
 26 27  1  6
 25 28  1  6
 17 29  1  6
 28 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  2  0
 31 34  1  0
 24 35  1  0
 35 36  2  0
 35 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 11 46  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4538168

    ---

Associated Targets(non-human)

Chikungunya virus (1339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 598.73Molecular Weight (Monoisotopic): 598.3142AlogP: 3.56#Rotatable Bonds: 10
Polar Surface Area: 147.43Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.22CX Basic pKa: CX LogP: 4.85CX LogD: 4.85
Aromatic Rings: Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: 2.81

References

1. Nothias-Esposito M, Nothias LF, Da Silva RR, Retailleau P, Zhang Z, Leyssen P, Roussi F, Touboul D, Paolini J, Dorrestein PC, Litaudon M..  (2019)  Investigation of Premyrsinane and Myrsinane Esters in Euphorbia cupanii and Euphobia pithyusa with MS2LDA and Combinatorial Molecular Network Annotation Propagation.,  82  (6): [PMID:31181921] [10.1021/acs.jnatprod.8b00916]

Source