2-(2-Methylphenoxy)-N-(pyrazin-2-yl)acetamide

ID: ALA4538190

PubChem CID: 155549212

Max Phase: Preclinical

Molecular Formula: C13H13N3O2

Molecular Weight: 243.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1OCC(=O)Nc1cnccn1

Standard InChI:  InChI=1S/C13H13N3O2/c1-10-4-2-3-5-11(10)18-9-13(17)16-12-8-14-6-7-15-12/h2-8H,9H2,1H3,(H,15,16,17)

Standard InChI Key:  FZBBBJIQFQBTKJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   31.8897  -28.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8885  -29.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5966  -29.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3062  -29.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3034  -28.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5948  -28.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0096  -28.0960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7188  -28.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4250  -28.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1342  -28.4966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4219  -27.2735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8404  -28.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8317  -27.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5350  -26.8554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2470  -27.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5923  -27.2848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5510  -28.4888    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2558  -28.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 18 15  2  0
 13 12  1  0
 13 14  2  0
 14 15  1  0
  6 16  1  0
 12 17  2  0
 17 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538190

    ---

Associated Targets(Human)

NOTUM Tchem Palmitoleoyl-protein carboxylesterase NOTUM (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 243.27Molecular Weight (Monoisotopic): 243.1008AlogP: 1.80#Rotatable Bonds: 4
Polar Surface Area: 64.11Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.90CX Basic pKa: 0.07CX LogP: 1.40CX LogD: 1.40
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.89Np Likeness Score: -1.97

References

1. Atkinson BN, Steadman D, Zhao Y, Sipthorp J, Vecchia L, Ruza RR, Jeganathan F, Lines G, Frew S, Monaghan A, Kjær S, Bictash M, Jones EY, Fish PV..  (2019)  Discovery of 2-phenoxyacetamides as inhibitors of the Wnt-depalmitoleating enzyme NOTUM from an X-ray fragment screen.,  10  (8): [PMID:31534655] [10.1039/C9MD00096H]

Source