The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-((5-Fluoro-4-((4-fluorophenyl)amino)pyrimidin-2-yl)-amino)-1H-pyrazol-1-yl)-N-hydroxyheptanamide ID: ALA4538220
PubChem CID: 141728855
Max Phase: Preclinical
Molecular Formula: C20H23F2N7O2
Molecular Weight: 431.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCCn1cc(Nc2ncc(F)c(Nc3ccc(F)cc3)n2)cn1)NO
Standard InChI: InChI=1S/C20H23F2N7O2/c21-14-6-8-15(9-7-14)25-19-17(22)12-23-20(27-19)26-16-11-24-29(13-16)10-4-2-1-3-5-18(30)28-31/h6-9,11-13,31H,1-5,10H2,(H,28,30)(H2,23,25,26,27)
Standard InChI Key: CCGTZVGZDKFRHE-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
19.9712 -9.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6836 -9.6749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3948 -9.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1040 -9.6732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8147 -9.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8139 -8.4419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0964 -8.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3886 -8.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5228 -9.6720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2342 -9.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9806 -9.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5309 -8.9878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1173 -8.2764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3141 -8.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3482 -8.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7593 -9.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5806 -9.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9959 -10.3987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8172 -10.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9721 -8.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2605 -8.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5483 -8.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5522 -9.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2645 -9.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2283 -11.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8394 -8.0386 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.0496 -11.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4648 -11.8137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4598 -10.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2861 -11.8109 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6741 -8.0379 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
5 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
12 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
1 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 1 1 0
19 25 1 0
22 26 1 0
25 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
8 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.45Molecular Weight (Monoisotopic): 431.1881AlogP: 3.89#Rotatable Bonds: 11Polar Surface Area: 116.99Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.90CX Basic pKa: 1.91CX LogP: 3.44CX LogD: 3.43Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: -1.64
References 1. Liang X, Zang J, Li X, Tang S, Huang M, Geng M, Chou CJ, Li C, Cao Y, Xu W, Liu H, Zhang Y.. (2019) Discovery of Novel Janus Kinase (JAK) and Histone Deacetylase (HDAC) Dual Inhibitors for the Treatment of Hematological Malignancies., 62 (8): [PMID:30901208 ] [10.1021/acs.jmedchem.8b01597 ]