(S)-3-(4-(3-(4-(2-ethyl-2-hydroxybutoxy)-3-methylphenyl)pentan-3-yl)-2-methylphenoxy)propane-1,2-diol

ID: ALA4538386

PubChem CID: 155548806

Max Phase: Preclinical

Molecular Formula: C28H42O5

Molecular Weight: 458.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(O)(CC)COc1ccc(C(CC)(CC)c2ccc(OC[C@@H](O)CO)c(C)c2)cc1C

Standard InChI:  InChI=1S/C28H42O5/c1-7-27(31,8-2)19-33-26-14-12-23(16-21(26)6)28(9-3,10-4)22-11-13-25(20(5)15-22)32-18-24(30)17-29/h11-16,24,29-31H,7-10,17-19H2,1-6H3/t24-/m0/s1

Standard InChI Key:  YPCNBQSTXNQESO-DEOSSOPVSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   14.1470  -21.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7387  -22.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5636  -22.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4528  -20.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1429  -20.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9853  -19.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9846  -19.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8097  -20.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3117  -21.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3105  -22.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0254  -22.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7419  -22.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7391  -21.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0236  -20.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1681  -21.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1679  -22.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8831  -22.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5971  -22.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5913  -21.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8755  -20.9705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0252  -23.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8858  -23.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3137  -22.6147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5957  -22.6371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8815  -22.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1666  -22.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4524  -22.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7376  -22.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1659  -23.4610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0261  -22.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7470  -23.4325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7304  -21.1772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9802  -23.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 13  4  1  0
  4 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
 17 22  1  0
 18 23  1  0
 10 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  1
 23 30  1  0
 30  2  1  0
  2 31  1  0
  1 32  1  0
  3 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538386

    ---

Associated Targets(Human)

VDR Tclin Vitamin D receptor (26531 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.64Molecular Weight (Monoisotopic): 458.3032AlogP: 5.07#Rotatable Bonds: 13
Polar Surface Area: 79.15Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.48CX Basic pKa: CX LogP: 5.98CX LogD: 5.98
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: 0.00

References

1. Misawa T, Tsuji G, Takahashi T, Ochiai E, Takagi KI, Horie K, Kakuda S, Takimoto-Kamimura M, Kurihara M, Demizu Y..  (2018)  Structural development of non-secosteroidal vitamin D receptor (VDR) ligands without any asymmetric carbon.,  26  (23-24): [PMID:30446437] [10.1016/j.bmc.2018.11.008]

Source