The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-methoxy-2-phenyl-4-(2-(2-phenylethylidene)hydrazinyl)quinoline ID: ALA4538465
PubChem CID: 155549262
Max Phase: Preclinical
Molecular Formula: C24H21N3O
Molecular Weight: 367.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(-c3ccccc3)cc(N/N=C/Cc3ccccc3)c2c1
Standard InChI: InChI=1S/C24H21N3O/c1-28-20-12-13-22-21(16-20)24(17-23(26-22)19-10-6-3-7-11-19)27-25-15-14-18-8-4-2-5-9-18/h2-13,15-17H,14H2,1H3,(H,26,27)/b25-15+
Standard InChI Key: DIUZIOROTORYAL-MFKUBSTISA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
3.7998 -28.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7986 -28.8929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5067 -29.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5049 -27.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2135 -28.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2142 -28.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9228 -29.2959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6310 -28.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6263 -28.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9172 -27.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3403 -29.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9129 -26.8424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6184 -26.4300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0920 -27.6649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0918 -26.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3283 -26.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3386 -30.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0471 -30.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -30.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7484 -29.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0393 -28.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0338 -26.4225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7437 -26.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7431 -27.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4521 -28.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1586 -27.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1516 -26.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4420 -26.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
10 12 1 0
12 13 1 0
1 14 1 0
14 15 1 0
13 16 2 0
11 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 11 1 0
16 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 367.45Molecular Weight (Monoisotopic): 367.1685AlogP: 5.55#Rotatable Bonds: 6Polar Surface Area: 46.51Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.19CX LogP: 5.60CX LogD: 5.57Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -0.73
References 1. Hussein B, Ikhmais B, Kadirvel M, Magwaza RN, Halbert G, Bryce RA, Stratford IJ, Freeman S.. (2019) Discovery of potent 4-aminoquinoline hydrazone inhibitors of NRH:quinoneoxidoreductase-2 (NQO2)., 182 [PMID:31514018 ] [10.1016/j.ejmech.2019.111649 ]