(S)-1-(((R)-1-(3-Benzylphenyl)ethyl)amino)-3-(4-hydroxy-2,6-dimethylphenyl)-1-oxopropan-2-aminium Trifluoroacetate

ID: ALA4538540

PubChem CID: 155549043

Max Phase: Preclinical

Molecular Formula: C28H31F3N2O4

Molecular Weight: 402.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(O)cc(C)c1C[C@H](N)C(=O)N[C@H](C)c1cccc(Cc2ccccc2)c1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C26H30N2O2.C2HF3O2/c1-17-12-23(29)13-18(2)24(17)16-25(27)26(30)28-19(3)22-11-7-10-21(15-22)14-20-8-5-4-6-9-20;3-2(4,5)1(6)7/h4-13,15,19,25,29H,14,16,27H2,1-3H3,(H,28,30);(H,6,7)/t19-,25+;/m1./s1

Standard InChI Key:  QXCKSQSCFNLQCL-UFABNHQSSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   29.0351   -3.2605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.7428   -2.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4505   -3.2605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.7367   -3.6650    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.7458   -2.0347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4550   -1.6288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0396   -1.6235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2875   -2.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2864   -3.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9944   -4.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7041   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7013   -2.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9927   -2.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4074   -2.5196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1167   -2.9255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1164   -3.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8248   -4.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5320   -3.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5263   -2.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8173   -2.5113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2310   -2.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9416   -2.9032    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6463   -2.4894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3570   -2.8928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1773   -2.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8302   -2.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6404   -1.6722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.8314   -3.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5412   -4.1024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2469   -3.6886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2383   -2.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5279   -2.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5181   -1.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9581   -4.0911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3630   -3.6522    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.1254   -4.1684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2250   -1.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  5  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 23 27  2  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 32 33  1  0
 30 34  1  0
 24 35  1  6
 28 36  1  0
 21 37  1  0
M  END

Associated Targets(Human)

OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprd1 Delta opioid receptor (3911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2307AlogP: 4.35#Rotatable Bonds: 7
Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.76CX Basic pKa: 8.05CX LogP: 5.33CX LogD: 4.71
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: 0.02

References

1. Henry SP, Fernandez TJ, Anand JP, Griggs NW, Traynor JR, Mosberg HI..  (2019)  Structural Simplification of a Tetrahydroquinoline-Core Peptidomimetic μ-Opioid Receptor (MOR) Agonist/δ-Opioid Receptor (DOR) Antagonist Produces Improved Metabolic Stability.,  62  (8): [PMID:30924650] [10.1021/acs.jmedchem.9b00219]

Source