5-(Pyrazine-2-carboxamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid

ID: ALA4538561

PubChem CID: 155549217

Max Phase: Preclinical

Molecular Formula: C23H22N4O3

Molecular Weight: 402.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(NC(=O)c2cnccn2)cc(-c2ccc(C3CCNCC3)cc2)c1

Standard InChI:  InChI=1S/C23H22N4O3/c28-22(21-14-25-9-10-26-21)27-20-12-18(11-19(13-20)23(29)30)16-3-1-15(2-4-16)17-5-7-24-8-6-17/h1-4,9-14,17,24H,5-8H2,(H,27,28)(H,29,30)

Standard InChI Key:  FSXSJQSLCYEKDE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   25.3315   -4.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3304   -5.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0384   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7481   -5.3879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7452   -4.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0366   -4.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0401   -6.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3307   -7.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3301   -7.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0382   -8.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7484   -7.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7455   -7.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0428   -9.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3337   -9.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3326  -10.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0390  -10.6941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7480  -10.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7508   -9.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4514   -4.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1607   -4.5599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4483   -3.3368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6237   -4.1604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9161   -4.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2083   -4.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9163   -5.3863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2117   -3.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5048   -2.9346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7962   -3.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7990   -4.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5065   -4.5695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
  5 19  1  0
 19 20  2  0
 19 21  1  0
  1 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538561

    ---

Associated Targets(Human)

P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.45Molecular Weight (Monoisotopic): 402.1692AlogP: 3.56#Rotatable Bonds: 5
Polar Surface Area: 104.21Molecular Species: ZWITTERIONHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.84CX Basic pKa: 10.07CX LogP: -0.05CX LogD: -0.05
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -1.07

References

1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C..  (2019)  Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists.,  181  [PMID:31376563] [10.1016/j.ejmech.2019.111564]

Source