The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1E,4E)-6-(1-(3,4,5-trimethoxybenzoylthio)pentyl)-5,8-dimethoxy-1,4-naphthoquinone-dioxime ID: ALA4538567
PubChem CID: 155549269
Max Phase: Preclinical
Molecular Formula: C27H32N2O8S
Molecular Weight: 544.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC(SC(=O)c1cc(OC)c(OC)c(OC)c1)c1cc(OC)c2c(c1OC)/C(=N/O)C=C/C2=N\O
Standard InChI: InChI=1S/C27H32N2O8S/c1-7-8-9-22(38-27(30)15-12-20(34-3)26(37-6)21(13-15)35-4)16-14-19(33-2)23-17(28-31)10-11-18(29-32)24(23)25(16)36-5/h10-14,22,31-32H,7-9H2,1-6H3/b28-17+,29-18+
Standard InChI Key: NZYZTJMTTCHZBY-POAOKBCDSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
29.1909 -12.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9074 -12.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9044 -11.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1891 -11.0454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4761 -12.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4803 -11.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7698 -11.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0506 -11.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0463 -12.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7614 -12.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7585 -13.5229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0425 -13.9327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7750 -10.2181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0632 -9.8011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1859 -10.2204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8987 -9.8050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1907 -13.5233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.6224 -12.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6237 -13.5214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.4762 -13.9357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3363 -12.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3388 -13.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0526 -13.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3401 -14.7577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.3350 -11.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7655 -13.9312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4788 -13.5183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4779 -12.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7578 -12.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0475 -12.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1937 -13.9300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1912 -12.2779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7537 -11.4562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4660 -11.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1888 -11.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9077 -13.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0487 -11.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0475 -10.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 13 2 0
13 14 1 0
4 15 1 0
15 16 1 0
1 17 1 0
2 18 1 0
18 19 1 0
17 20 1 0
18 21 1 0
19 22 1 0
22 23 1 0
22 24 2 0
21 25 1 0
23 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 23 1 0
27 31 1 0
28 32 1 0
29 33 1 0
33 34 1 0
32 35 1 0
31 36 1 0
25 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.63Molecular Weight (Monoisotopic): 544.1879AlogP: 5.46#Rotatable Bonds: 11Polar Surface Area: 128.40Molecular Species: ACIDHBA: 11HBD: 2#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.99CX Basic pKa: ┄CX LogP: 4.83CX LogD: 2.56Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: 0.25
References 1. Huang G, Dong JY, Zhang QJ, Meng QQ, Zhao HR, Zhu BQ, Li SS.. (2019) Discovery and synthesis of sulfur-containing 6-substituted 5,8-dimethoxy-1,4-naphthoquinone oxime derivatives as new and potential anti-MDR cancer agents., 165 [PMID:30677614 ] [10.1016/j.ejmech.2019.01.005 ]