7-fluoro-6-(1-(6-(1-methyl-1H-pyrazol-4-yl)-1H-imidazo[4,5-b]pyrazin-1-yl)propyl)quinoline

ID: ALA4538592

PubChem CID: 155549474

Max Phase: Preclinical

Molecular Formula: C21H18FN7

Molecular Weight: 387.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(c1cc2cccnc2cc1F)n1cnc2ncc(-c3cnn(C)c3)nc21

Standard InChI:  InChI=1S/C21H18FN7/c1-3-19(15-7-13-5-4-6-23-17(13)8-16(15)22)29-12-25-20-21(29)27-18(10-24-20)14-9-26-28(2)11-14/h4-12,19H,3H2,1-2H3

Standard InChI Key:  NCNWNGLPCAPMQQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   25.0715  -20.8177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0704  -21.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7784  -22.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7766  -20.4088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4852  -20.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4900  -21.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2701  -21.8812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7474  -21.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2623  -20.5567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3650  -22.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6187  -21.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0714  -22.3225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4795  -23.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2789  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2588  -22.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5271  -22.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9838  -23.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3274  -22.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5792  -23.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3787  -23.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8631  -22.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6620  -22.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9198  -23.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7220  -23.3180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2672  -22.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0046  -21.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2030  -21.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2409  -24.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0339  -24.2066    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  2 10  1  0
 12 15  1  0
  7 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 23  2  0
 22 21  2  0
 21 18  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 17 28  1  0
 19 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538592

    ---

Associated Targets(Human)

MET Tclin Hepatocyte growth factor receptor (10718 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1993 (343 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.42Molecular Weight (Monoisotopic): 387.1608AlogP: 3.91#Rotatable Bonds: 4
Polar Surface Area: 74.31Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.04CX LogP: 3.17CX LogD: 3.16
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.47Np Likeness Score: -1.75

References

1. Zhao F, Zhang J, Zhang L, Hao Y, Shi C, Xia G, Yu J, Liu Y..  (2016)  Discovery and optimization of a series of imidazo[4,5-b]pyrazine derivatives as highly potent and exquisitely selective inhibitors of the mesenchymal-epithelial transition factor (c-Met) protein kinase.,  24  (18): [PMID:27448775] [10.1016/j.bmc.2016.07.019]

Source