N-(5-((4-(benzo[d]isoxazol-3-yl)pyrimidin-2-yl)amino)-4-(difluoromethoxy)-2-((2-(dimethylamino)ethyl)(methyl)amino)phenyl)acrylamide

ID: ALA4538613

PubChem CID: 126667282

Max Phase: Preclinical

Molecular Formula: C26H27F2N7O3

Molecular Weight: 523.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cc(Nc2nccc(-c3noc4ccccc34)n2)c(OC(F)F)cc1N(C)CCN(C)C

Standard InChI:  InChI=1S/C26H27F2N7O3/c1-5-23(36)30-18-14-19(22(37-25(27)28)15-20(18)35(4)13-12-34(2)3)32-26-29-11-10-17(31-26)24-16-8-6-7-9-21(16)38-33-24/h5-11,14-15,25H,1,12-13H2,2-4H3,(H,30,36)(H,29,31,32)

Standard InChI Key:  MZAITGJVRHSFJL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   32.0878   -2.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0866   -3.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7947   -3.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7929   -2.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5015   -2.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5063   -3.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2863   -3.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7637   -3.0810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2786   -2.4216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5421   -4.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9971   -5.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2535   -5.9028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0546   -6.0686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5987   -5.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3394   -4.6805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3031   -5.8607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0111   -5.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7164   -5.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4240   -5.4590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4251   -4.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7127   -4.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0081   -4.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7105   -3.4148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0017   -3.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9994   -2.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2951   -3.4187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7060   -1.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7131   -6.6836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0037   -7.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2977   -6.6778    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0004   -7.9065    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.1326   -4.2320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8405   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1321   -3.4148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5480   -4.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2559   -4.6395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.9634   -4.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2563   -5.4566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 18 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 20 32  1  0
 32 33  1  0
 32 34  1  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538613

    ---

Associated Targets(Human)

NCI-H1975 (4994 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-431 (6446 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.54Molecular Weight (Monoisotopic): 523.2143AlogP: 4.75#Rotatable Bonds: 11
Polar Surface Area: 108.65Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.18CX Basic pKa: 8.86CX LogP: 4.86CX LogD: 3.39
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.46

References

1. Zhou P, Chen G, Gao M, Wu J..  (2018)  Design, synthesis and evaluation of the osimertinib analogue (C-005) as potent EGFR inhibitor against NSCLC.,  26  (23-24): [PMID:30442506] [10.1016/j.bmc.2018.10.018]

Source