The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-((4-(benzo[d]isoxazol-3-yl)pyrimidin-2-yl)amino)-4-(difluoromethoxy)-2-((2-(dimethylamino)ethyl)(methyl)amino)phenyl)acrylamide ID: ALA4538613
PubChem CID: 126667282
Max Phase: Preclinical
Molecular Formula: C26H27F2N7O3
Molecular Weight: 523.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(-c3noc4ccccc34)n2)c(OC(F)F)cc1N(C)CCN(C)C
Standard InChI: InChI=1S/C26H27F2N7O3/c1-5-23(36)30-18-14-19(22(37-25(27)28)15-20(18)35(4)13-12-34(2)3)32-26-29-11-10-17(31-26)24-16-8-6-7-9-21(16)38-33-24/h5-11,14-15,25H,1,12-13H2,2-4H3,(H,30,36)(H,29,31,32)
Standard InChI Key: MZAITGJVRHSFJL-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
32.0878 -2.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0866 -3.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7947 -3.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7929 -2.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5015 -2.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5063 -3.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2863 -3.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7637 -3.0810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2786 -2.4216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5421 -4.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9971 -5.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2535 -5.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0546 -6.0686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5987 -5.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3394 -4.6805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3031 -5.8607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0111 -5.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7164 -5.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4240 -5.4590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4251 -4.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7127 -4.2320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0081 -4.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7105 -3.4148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0017 -3.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9994 -2.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2951 -3.4187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7060 -1.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7131 -6.6836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0037 -7.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2977 -6.6778 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.0004 -7.9065 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.1326 -4.2320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8405 -4.6402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1321 -3.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5480 -4.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2559 -4.6395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.9634 -4.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2563 -5.4566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
7 10 1 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
18 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
20 32 1 0
32 33 1 0
32 34 1 0
33 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.54Molecular Weight (Monoisotopic): 523.2143AlogP: 4.75#Rotatable Bonds: 11Polar Surface Area: 108.65Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.18CX Basic pKa: 8.86CX LogP: 4.86CX LogD: 3.39Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.46
References 1. Zhou P, Chen G, Gao M, Wu J.. (2018) Design, synthesis and evaluation of the osimertinib analogue (C-005) as potent EGFR inhibitor against NSCLC., 26 (23-24): [PMID:30442506 ] [10.1016/j.bmc.2018.10.018 ]