The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-(3-(2-(2-Chloro-3-(trifluoromethyl)phenyl)acetamido)-4-fluorophenoxy)benzo[d]thiazol-2-yl)cyclopropanecarboxamide ID: ALA4538649
PubChem CID: 141735096
Max Phase: Preclinical
Molecular Formula: C26H18ClF4N3O3S
Molecular Weight: 563.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1cccc(C(F)(F)F)c1Cl)Nc1cc(Oc2ccc3nc(NC(=O)C4CC4)sc3c2)ccc1F
Standard InChI: InChI=1S/C26H18ClF4N3O3S/c27-23-14(2-1-3-17(23)26(29,30)31)10-22(35)32-20-11-15(6-8-18(20)28)37-16-7-9-19-21(12-16)38-25(33-19)34-24(36)13-4-5-13/h1-3,6-9,11-13H,4-5,10H2,(H,32,35)(H,33,34,36)
Standard InChI Key: AQAWZYWGYFRZBP-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
37.4408 -2.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4397 -3.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1477 -4.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8574 -3.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8545 -2.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1459 -2.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5657 -4.1981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2728 -3.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9778 -4.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9702 -2.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2666 -2.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6835 -2.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6872 -3.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4627 -4.0316 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.9383 -3.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4567 -2.7142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7330 -2.5631 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.7316 -4.1991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0242 -3.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0249 -2.9728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7555 -3.3670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.1609 -2.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9781 -2.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7491 -1.9516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3162 -4.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6088 -3.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6142 -2.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9077 -2.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1987 -2.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2007 -3.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9078 -4.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6863 -3.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6826 -2.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3235 -2.5649 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.9087 -1.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6170 -1.3367 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.2015 -1.3349 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.9011 -0.9245 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 13 1 0
12 10 1 0
10 11 2 0
11 8 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 12 1 0
1 17 1 0
2 18 1 0
18 19 1 0
19 20 2 0
15 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
19 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 23 1 0
33 32 1 0
23 33 1 0
27 34 1 0
28 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.96Molecular Weight (Monoisotopic): 563.0694AlogP: 7.43#Rotatable Bonds: 7Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.90CX Basic pKa: ┄CX LogP: 7.01CX LogD: 6.90Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.23Np Likeness Score: -2.13
References 1. Zhang H, Xu L, Qin X, Chen X, Cong H, Hu L, Chen L, Miao Z, Zhang W, Cai Z, Zhuang C.. (2019) N -(7-Cyano-6-(4-fluoro-3-(2-(3-(trifluoromethyl)phenyl)acetamido)phenoxy)benzo[d ]thiazol-2-yl)cyclopropanecarboxamide (TAK-632) Analogues as Novel Necroptosis Inhibitors by Targeting Receptor-Interacting Protein Kinase 3 (RIPK3): Synthesis, Structure-Activity Relationships, and in Vivo Efficacy., 62 (14): [PMID:31095385 ] [10.1021/acs.jmedchem.9b00611 ]