The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyanoethyl 4-(4-((5-chloro-4-((2-(methylcarbamoyl)phenyl)amino)pyrimidin-2-yl)amino)benzoyl)piperazine-1-carbodithioate ID: ALA4538710
PubChem CID: 155548815
Max Phase: Preclinical
Molecular Formula: C27H27ClN8O2S2
Molecular Weight: 595.15
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)c1ccccc1Nc1nc(Nc2ccc(C(=O)N3CCN(C(=S)SCCC#N)CC3)cc2)ncc1Cl
Standard InChI: InChI=1S/C27H27ClN8O2S2/c1-30-24(37)20-5-2-3-6-22(20)33-23-21(28)17-31-26(34-23)32-19-9-7-18(8-10-19)25(38)35-12-14-36(15-13-35)27(39)40-16-4-11-29/h2-3,5-10,17H,4,12-16H2,1H3,(H,30,37)(H2,31,32,33,34)
Standard InChI Key: AKGPHMOJVOKNTN-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
4.1423 -3.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1412 -4.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8492 -4.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5589 -4.3519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5561 -3.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8474 -3.1240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2622 -3.1180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9715 -3.5239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4345 -3.1244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7269 -3.5332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0192 -3.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3121 -3.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3118 -4.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0246 -4.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7288 -4.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9712 -4.3388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6796 -4.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3868 -4.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3810 -3.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6721 -3.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0965 -4.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1007 -5.5555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8022 -4.3261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5088 -4.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2123 -4.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2124 -3.5105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5027 -3.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7931 -3.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0200 -2.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7281 -1.8979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3126 -1.8966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3134 -1.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4331 -4.7604 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.9196 -3.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6278 -3.5086 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.9185 -2.2838 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3350 -3.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0432 -3.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7504 -3.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4552 -2.6920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 8 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
11 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
2 33 1 0
26 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
39 40 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.15Molecular Weight (Monoisotopic): 594.1387AlogP: 4.67#Rotatable Bonds: 8Polar Surface Area: 126.28Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.47CX Basic pKa: 2.48CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -1.74
References 1. Su Y, Li R, Ning X, Lin Z, Zhao X, Zhou J, Liu J, Jin Y, Yin Y.. (2019) Discovery of 2,4-diarylaminopyrimidine derivatives bearing dithiocarbamate moiety as novel FAK inhibitors with antitumor and anti-angiogenesis activities., 177 [PMID:31129452 ] [10.1016/j.ejmech.2019.05.048 ]