The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(pyridin-2-yl)-N-(5-((1S,3R)-3-((6-(2-(3-(trifluoromethoxy)phenyl)acetamido)pyridazin-3-yl)methyl)cyclopentyl)-1,3,4-thiadiazol-2-yl)acetamide ID: ALA4538736
PubChem CID: 155549004
Max Phase: Preclinical
Molecular Formula: C28H26F3N7O3S
Molecular Weight: 597.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(C[C@@H]2CC[C@H](c3nnc(NC(=O)Cc4ccccn4)s3)C2)nn1
Standard InChI: InChI=1S/C28H26F3N7O3S/c29-28(30,31)41-22-6-3-4-17(14-22)15-24(39)33-23-10-9-21(35-36-23)13-18-7-8-19(12-18)26-37-38-27(42-26)34-25(40)16-20-5-1-2-11-32-20/h1-6,9-11,14,18-19H,7-8,12-13,15-16H2,(H,33,36,39)(H,34,38,40)/t18-,19+/m1/s1
Standard InChI Key: RKXFRFVCUKPFPF-MOPGFXCFSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
8.7761 -27.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4877 -28.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1998 -27.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9075 -28.2116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6150 -27.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6159 -26.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9035 -26.5689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1948 -26.9829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3274 -26.5686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0396 -26.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7511 -26.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0402 -27.8021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4632 -26.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4597 -27.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1710 -28.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8835 -27.8009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8802 -26.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1684 -26.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5903 -26.5596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2998 -26.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0099 -26.5536 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.3033 -27.7906 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.0071 -27.3759 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.7426 -27.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0778 -27.8669 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.4864 -26.5999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6650 -26.5999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4107 -27.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6951 -27.7926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9864 -27.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2715 -27.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9925 -26.5533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5628 -27.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5730 -26.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8692 -26.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1534 -26.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1499 -27.3573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8584 -27.7715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4471 -27.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7014 -28.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5227 -28.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1100 -27.3099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 6
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
27 28 2 0
24 26 2 0
25 24 1 0
26 27 1 0
28 25 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 24 1 6
40 41 1 0
41 1 1 0
1 42 1 0
42 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.62Molecular Weight (Monoisotopic): 597.1770AlogP: 5.11#Rotatable Bonds: 10Polar Surface Area: 131.88Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.93CX Basic pKa: 4.33CX LogP: 5.10CX LogD: 4.57Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.26Np Likeness Score: -1.51
References 1. Zimmermann SC, Duvall B, Tsukamoto T.. (2018) Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase., 62 (1): [PMID:29969024 ] [10.1021/acs.jmedchem.8b00327 ]