6-chloro-N-((4,4-difluorocyclohexyl)methyl)-2-(3-(dimethylamino)-3-oxopropylamino)quinoline-5-carboxamide

ID: ALA4538740

PubChem CID: 118566616

Max Phase: Preclinical

Molecular Formula: C22H27ClF2N4O2

Molecular Weight: 452.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)CCNc1ccc2c(C(=O)NCC3CCC(F)(F)CC3)c(Cl)ccc2n1

Standard InChI:  InChI=1S/C22H27ClF2N4O2/c1-29(2)19(30)9-12-26-18-6-3-15-17(28-18)5-4-16(23)20(15)21(31)27-13-14-7-10-22(24,25)11-8-14/h3-6,14H,7-13H2,1-2H3,(H,26,28)(H,27,31)

Standard InChI Key:  NRDZOWINXSSAGN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   30.0110  -10.3634    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.1859  -10.3634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5985  -11.0779    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.4757   -9.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4745  -10.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9030   -9.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1876   -9.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9059  -10.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1886  -10.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1870  -11.6222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9020  -12.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6201  -11.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6182  -10.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1852   -8.3213    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.9019  -12.8621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6164  -13.2747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6163  -14.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3308  -14.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3307  -15.3374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0454  -14.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6161  -15.7499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0452  -15.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6160   -9.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3321   -9.5501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6129   -8.3152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0451   -9.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7611   -9.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7619  -10.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4739  -10.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1882   -9.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4716   -9.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  9  1  0
  8  6  1  0
  6  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  7 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 19 22  1  0
  6 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 31  1  0
 28 29  1  0
 29  2  1  0
  2 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

P2RX7 Tchem P2X purinoceptor 7 (5534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.93Molecular Weight (Monoisotopic): 452.1791AlogP: 4.33#Rotatable Bonds: 7
Polar Surface Area: 74.33Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.77CX LogP: 2.83CX LogD: 2.83
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.30

References

1. Rech JC, Bhattacharya A, Letavic MA, Savall BM..  (2016)  The evolution of P2X7 antagonists with a focus on CNS indications.,  26  (16): [PMID:27426304] [10.1016/j.bmcl.2016.06.048]

Source