The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-N-((4,4-difluorocyclohexyl)methyl)-2-(3-(dimethylamino)-3-oxopropylamino)quinoline-5-carboxamide ID: ALA4538740
PubChem CID: 118566616
Max Phase: Preclinical
Molecular Formula: C22H27ClF2N4O2
Molecular Weight: 452.93
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)CCNc1ccc2c(C(=O)NCC3CCC(F)(F)CC3)c(Cl)ccc2n1
Standard InChI: InChI=1S/C22H27ClF2N4O2/c1-29(2)19(30)9-12-26-18-6-3-15-17(28-18)5-4-16(23)20(15)21(31)27-13-14-7-10-22(24,25)11-8-14/h3-6,14H,7-13H2,1-2H3,(H,26,28)(H,27,31)
Standard InChI Key: NRDZOWINXSSAGN-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
30.0110 -10.3634 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.1859 -10.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5985 -11.0779 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.4757 -9.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4745 -10.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9030 -9.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1876 -9.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9059 -10.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1886 -10.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1870 -11.6222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9020 -12.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6201 -11.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6182 -10.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1852 -8.3213 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.9019 -12.8621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6164 -13.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6163 -14.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3308 -14.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3307 -15.3374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0454 -14.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6161 -15.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0452 -15.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6160 -9.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3321 -9.5501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6129 -8.3152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0451 -9.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7611 -9.5448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7619 -10.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4739 -10.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1882 -9.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4716 -9.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
7 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
6 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 31 1 0
28 29 1 0
29 2 1 0
2 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.93Molecular Weight (Monoisotopic): 452.1791AlogP: 4.33#Rotatable Bonds: 7Polar Surface Area: 74.33Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.77CX LogP: 2.83CX LogD: 2.83Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.30
References 1. Rech JC, Bhattacharya A, Letavic MA, Savall BM.. (2016) The evolution of P2X7 antagonists with a focus on CNS indications., 26 (16): [PMID:27426304 ] [10.1016/j.bmcl.2016.06.048 ]