The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pallidol ID: ALA4538773
PubChem CID: 155549180
Max Phase: Preclinical
Molecular Formula: C28H22O6
Molecular Weight: 454.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Oc1ccc([C@@H]2c3cc(O)cc(O)c3[C@H]3[C@H](c4ccc(O)cc4)c4cc(O)cc(O)c4[C@@H]23)cc1
Standard InChI: InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-19-9-17(31)11-21(33)25(19)28-24(14-3-7-16(30)8-4-14)20-10-18(32)12-22(34)26(20)27(23)28/h1-12,23-24,27-34H/t23-,24-,27-,28-/m1/s1
Standard InChI Key: FNDQTDQVYBBBQY-NFFAYCCRSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
22.5248 -4.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3420 -4.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6025 -5.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4188 -5.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0409 -3.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8177 -3.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2245 -3.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4503 -3.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0373 -2.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2223 -2.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8114 -1.6182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9972 -3.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6602 -4.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3983 -4.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4747 -3.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8070 -2.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0715 -3.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2170 -2.8891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4037 -2.6300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1249 -3.5989 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.0040 -5.8730 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.8265 -5.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4192 -6.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8273 -7.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6412 -7.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0453 -6.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6349 -5.8573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0529 -7.9729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9403 -5.6536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2792 -5.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5392 -5.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4591 -6.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1250 -6.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8624 -6.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5280 -6.9337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7152 -6.6617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 30 1 0
29 3 1 0
2 3 1 0
3 4 1 0
4 13 1 0
12 2 1 0
1 5 1 1
6 7 2 0
7 5 1 0
5 8 2 0
8 9 1 0
9 10 2 0
10 6 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
17 19 1 0
2 20 1 1
3 21 1 1
4 22 1 1
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
34 35 1 0
32 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.48Molecular Weight (Monoisotopic): 454.1416AlogP: 5.08#Rotatable Bonds: 2Polar Surface Area: 121.38Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.11CX Basic pKa: ┄CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: 0.78
References 1. Nagumo M, Ninomiya M, Oshima N, Itoh T, Tanaka K, Nishina A, Koketsu M.. (2019) Comparative analysis of stilbene and benzofuran neolignan derivatives as acetylcholinesterase inhibitors with neuroprotective and anti-inflammatory activities., 29 (17): [PMID:31350127 ] [10.1016/j.bmcl.2019.07.026 ]