Pallidol

ID: ALA4538773

PubChem CID: 155549180

Max Phase: Preclinical

Molecular Formula: C28H22O6

Molecular Weight: 454.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1ccc([C@@H]2c3cc(O)cc(O)c3[C@H]3[C@H](c4ccc(O)cc4)c4cc(O)cc(O)c4[C@@H]23)cc1

Standard InChI:  InChI=1S/C28H22O6/c29-15-5-1-13(2-6-15)23-19-9-17(31)11-21(33)25(19)28-24(14-3-7-16(30)8-4-14)20-10-18(32)12-22(34)26(20)27(23)28/h1-12,23-24,27-34H/t23-,24-,27-,28-/m1/s1

Standard InChI Key:  FNDQTDQVYBBBQY-NFFAYCCRSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   22.5248   -4.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3420   -4.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6025   -5.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4188   -5.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0409   -3.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8177   -3.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2245   -3.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4503   -3.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0373   -2.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2223   -2.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8114   -1.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9972   -3.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6602   -4.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3983   -4.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4747   -3.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8070   -2.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0715   -3.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2170   -2.8891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4037   -2.6300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1249   -3.5989    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.0040   -5.8730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.8265   -5.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4192   -6.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8273   -7.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6412   -7.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0453   -6.5567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6349   -5.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0529   -7.9729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9403   -5.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2792   -5.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5392   -5.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4591   -6.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1250   -6.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8624   -6.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5280   -6.9337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7152   -6.6617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1 30  1  0
 29  3  1  0
  2  3  1  0
  3  4  1  0
  4 13  1  0
 12  2  1  0
  1  5  1  1
  6  7  2  0
  7  5  1  0
  5  8  2  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 17 19  1  0
  2 20  1  1
  3 21  1  1
  4 22  1  1
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 34 35  1  0
 32 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4538773

    ---

Associated Targets(non-human)

ache Acetylcholinesterase (12221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-12 (7051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.48Molecular Weight (Monoisotopic): 454.1416AlogP: 5.08#Rotatable Bonds: 2
Polar Surface Area: 121.38Molecular Species: NEUTRALHBA: 6HBD: 6
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.11CX Basic pKa: CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: 0.78

References

1. Nagumo M, Ninomiya M, Oshima N, Itoh T, Tanaka K, Nishina A, Koketsu M..  (2019)  Comparative analysis of stilbene and benzofuran neolignan derivatives as acetylcholinesterase inhibitors with neuroprotective and anti-inflammatory activities.,  29  (17): [PMID:31350127] [10.1016/j.bmcl.2019.07.026]

Source