The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-3-(4-(((2-(2-methyl-1H-indol-3-yl)acetamido)oxy)methyl)phenyl)acrylamide ID: ALA4538830
PubChem CID: 155549392
Max Phase: Preclinical
Molecular Formula: C21H21N3O4
Molecular Weight: 379.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c2ccccc2c1CC(=O)NOCc1ccc(/C=C/C(=O)NO)cc1
Standard InChI: InChI=1S/C21H21N3O4/c1-14-18(17-4-2-3-5-19(17)22-14)12-21(26)24-28-13-16-8-6-15(7-9-16)10-11-20(25)23-27/h2-11,22,27H,12-13H2,1H3,(H,23,25)(H,24,26)/b11-10+
Standard InChI Key: UVFBUOYGAVJJQE-ZHACJKMWSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
22.7148 -13.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7137 -14.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4217 -15.1455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1314 -14.7360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1286 -13.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4200 -13.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0057 -15.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2983 -14.7354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8347 -13.5021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5440 -13.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2502 -13.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9594 -13.9027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.2471 -12.6796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6656 -13.4915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5903 -15.1434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8829 -14.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1748 -15.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8835 -13.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4675 -14.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3796 -13.9232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5804 -13.7527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7176 -15.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1715 -14.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3742 -14.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1218 -15.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6729 -16.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4682 -15.8411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9862 -13.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 23 1 0
22 19 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 379.42Molecular Weight (Monoisotopic): 379.1532AlogP: 2.79#Rotatable Bonds: 7Polar Surface Area: 103.45Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.07CX Basic pKa: ┄CX LogP: 2.55CX LogD: 2.48Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.29Np Likeness Score: -0.57
References 1. Pflieger M, Hamacher A, Öz T, Horstick-Muche N, Boesen B, Schrenk C, Kassack MU, Kurz T.. (2019) Novel α,β-unsaturated hydroxamic acid derivatives overcome cisplatin resistance., 27 (19): [PMID:31431326 ] [10.1016/j.bmc.2019.07.052 ]