3-((1S,2S,5R)-4-oxo-6,8-dioxabicyclo[3.2.1]octan-2-yl)benzo[d]oxazol-2(3H)-one

ID: ALA4538920

PubChem CID: 1242619

Max Phase: Preclinical

Molecular Formula: C13H11NO5

Molecular Weight: 261.23

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C[C@H](n2c(=O)oc3ccccc32)[C@H]2CO[C@@H]1O2

Standard InChI:  InChI=1S/C13H11NO5/c15-9-5-8(11-6-17-12(9)18-11)14-7-3-1-2-4-10(7)19-13(14)16/h1-4,8,11-12H,5-6H2/t8-,11+,12+/m0/s1

Standard InChI Key:  SDNPWXVGSFCVMZ-XXILOJSOSA-N

Molfile:  

 
     RDKit          2D

 21 24  0  0  0  0  0  0  0  0999 V2000
   10.7271   -2.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7271   -2.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4425   -3.4040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1581   -2.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1581   -2.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4425   -1.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8754   -3.4093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9204   -1.2854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8820   -1.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8582   -1.7878    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0069   -1.7502    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0097   -3.4093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1180   -4.4056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9285   -4.2319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7023   -3.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2544   -3.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9993   -2.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1923   -2.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6411   -2.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8992   -3.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5468   -4.7842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  2  0
  5  8  1  0
  1  9  1  0
  9  8  1  0
  5 10  1  6
  1 11  1  6
  2 12  1  6
 12 16  1  0
 15 13  1  0
 13 14  1  0
 14 12  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 14 21  2  0
M  END

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 261.23Molecular Weight (Monoisotopic): 261.0637AlogP: 0.85#Rotatable Bonds: 1
Polar Surface Area: 70.67Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.20CX LogD: 1.20
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.76Np Likeness Score: 0.04

References

1. Giri GF, Danielli M, Marinelli RA, Spanevello RA..  (2016)  Cytotoxic effect of levoglucosenone and related derivatives against human hepatocarcinoma cell lines.,  26  (16): [PMID:27422336] [10.1016/j.bmcl.2016.07.007]

Source