The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-bromo-2-fluorobenzyloxy)benzoyl)-3-hydroxy-5-methylcyclohex-2-en-1-one ID: ALA4538931
PubChem CID: 155549396
Max Phase: Preclinical
Molecular Formula: C21H18BrFO4
Molecular Weight: 433.27
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1CC(=O)C(C(=O)c2cccc(OCc3ccc(Br)cc3F)c2)=C(O)C1
Standard InChI: InChI=1S/C21H18BrFO4/c1-12-7-18(24)20(19(25)8-12)21(26)13-3-2-4-16(9-13)27-11-14-5-6-15(22)10-17(14)23/h2-6,9-10,12,24H,7-8,11H2,1H3
Standard InChI Key: SMFUYNAVHXQTTP-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
14.4067 -14.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4056 -15.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1136 -15.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8233 -15.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8205 -14.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1118 -14.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6989 -14.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6987 -13.3930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9913 -14.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2817 -14.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5762 -14.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5721 -15.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2798 -15.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9915 -15.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2850 -13.3863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6983 -15.8400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5266 -14.2037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2359 -14.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9420 -14.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6497 -14.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3554 -14.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3528 -13.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6385 -12.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9358 -13.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6507 -15.4249 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.0584 -12.9669 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.8630 -15.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
10 15 1 0
14 16 2 0
5 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
22 26 1 0
12 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.27Molecular Weight (Monoisotopic): 432.0372AlogP: 5.16#Rotatable Bonds: 5Polar Surface Area: 63.60Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.38CX Basic pKa: ┄CX LogP: 4.77CX LogD: 1.86Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.52Np Likeness Score: -0.58
References 1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF.. (2019) Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors., 166 [PMID:30684868 ] [10.1016/j.ejmech.2019.01.032 ]