The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N-diethyl-N'-{2-[(E)-2-(4-(propan-2-yl)phenyl)ethenyl]quinazolin-4-yl}propane-1,3-diamine ID: ALA4539094
PubChem CID: 121453033
Max Phase: Preclinical
Molecular Formula: C26H34N4
Molecular Weight: 402.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCNc1nc(/C=C/c2ccc(C(C)C)cc2)nc2ccccc12
Standard InChI: InChI=1S/C26H34N4/c1-5-30(6-2)19-9-18-27-26-23-10-7-8-11-24(23)28-25(29-26)17-14-21-12-15-22(16-13-21)20(3)4/h7-8,10-17,20H,5-6,9,18-19H2,1-4H3,(H,27,28,29)/b17-14+
Standard InChI Key: GZRJMHYRKXPHMO-SAPNQHFASA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
19.8830 -11.3173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8875 -12.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1828 -12.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4777 -12.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7725 -12.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0623 -12.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3571 -12.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6480 -12.1582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9443 -12.5684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9450 -13.3874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2374 -13.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5294 -13.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5305 -12.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2356 -12.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6536 -13.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3618 -13.3837 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6553 -14.6117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3638 -15.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4660 -11.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1678 -10.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0707 -14.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7792 -15.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4861 -14.6058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1946 -15.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4844 -13.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5876 -10.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2984 -11.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5816 -10.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1913 -13.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9015 -14.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
9 14 2 0
10 15 1 0
15 16 2 0
16 7 1 0
15 17 1 0
17 18 1 0
19 4 1 0
20 19 2 0
1 20 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
1 26 1 0
26 27 1 0
26 28 1 0
25 29 1 0
24 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.59Molecular Weight (Monoisotopic): 402.2783AlogP: 6.07#Rotatable Bonds: 10Polar Surface Area: 41.05Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.94CX LogP: 6.73CX LogD: 4.22Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.03
References 1. Baska F, Sipos A, Őrfi Z, Nemes Z, Dobos J, Szántai-Kis C, Szabó E, Szénási G, Dézsi L, Hamar P, Cserepes MT, Tóvári J, Garamvölgyi R, Krekó M, Őrfi L.. (2019) Discovery and development of extreme selective inhibitors of the ITD and D835Y mutant FLT3 kinases., 184 [PMID:31614258 ] [10.1016/j.ejmech.2019.111710 ]