3-amino-N-[2-[4-[(3R)-3-(hydroxymethyl)piperazin-1-yl]phenyl]ethyl]-6-methyl-thieno[2,3-b]pyridine-2-carboxamide

ID: ALA4539113

PubChem CID: 153311008

Max Phase: Preclinical

Molecular Formula: C22H27N5O2S

Molecular Weight: 425.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2c(N)c(C(=O)NCCc3ccc(N4CCN[C@@H](CO)C4)cc3)sc2n1

Standard InChI:  InChI=1S/C22H27N5O2S/c1-14-2-7-18-19(23)20(30-22(18)26-14)21(29)25-9-8-15-3-5-17(6-4-15)27-11-10-24-16(12-27)13-28/h2-7,16,24,28H,8-13,23H2,1H3,(H,25,29)/t16-/m1/s1

Standard InChI Key:  VYSSWPBTCCCHHZ-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.7774  -10.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7763  -11.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4843  -11.8850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4825  -10.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1911  -10.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1964  -11.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9808  -11.7255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4592  -11.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9723  -10.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2197   -9.6151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2764  -11.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6895  -11.7578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6804  -10.3434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5067  -11.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9199  -12.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7370  -12.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1440  -13.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9602  -13.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3653  -12.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9468  -11.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1322  -11.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1824  -12.4430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0682  -11.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5930  -13.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4067  -13.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8134  -12.4324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4003  -11.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5805  -11.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8183  -13.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4127  -14.5570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
  2 23  1  0
 22 24  1  0
 22 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 25 29  1  1
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539113

    ---

Associated Targets(Human)

USP28 Tchem Ubiquitin carboxyl-terminal hydrolase 28 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
USP25 Tchem Ubiquitin carboxyl-terminal hydrolase 25 (268 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.56Molecular Weight (Monoisotopic): 425.1885AlogP: 1.93#Rotatable Bonds: 6
Polar Surface Area: 103.51Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.36CX LogP: 2.11CX LogD: 1.11
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.29

References

1.  (2017)  Thienopyridine carboxamides as ubiquitin-specific protease inhibitors, 

Source