The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-(Phenethylamino)-3-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-2H-indazol-2-yl)benzamide ID: ALA4539118
PubChem CID: 155550094
Max Phase: Preclinical
Molecular Formula: C28H33N5O2
Molecular Weight: 471.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc(-n2nc3c(c2C(=O)N2CCCCC2)CC(NCCc2ccccc2)CC3)cc1
Standard InChI: InChI=1S/C28H33N5O2/c29-27(34)21-9-12-23(13-10-21)33-26(28(35)32-17-5-2-6-18-32)24-19-22(11-14-25(24)31-33)30-16-15-20-7-3-1-4-8-20/h1,3-4,7-10,12-13,22,30H,2,5-6,11,14-19H2,(H2,29,34)
Standard InChI Key: OAPFEDKKCBUWMF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
28.9360 -26.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9360 -27.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6454 -27.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6454 -25.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1299 -27.4645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6106 -26.8060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1275 -26.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3507 -26.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3521 -27.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3827 -25.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1858 -25.1920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8306 -24.7529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7310 -25.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5311 -25.6335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7884 -24.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2392 -24.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4327 -24.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4246 -26.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8328 -27.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6493 -27.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0585 -26.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6453 -26.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8302 -26.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2276 -25.9903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5206 -26.4001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8122 -25.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1052 -26.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3980 -25.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6914 -26.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6923 -27.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4057 -27.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1093 -27.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8757 -26.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2854 -27.5101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2831 -26.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 9 1 0
8 4 1 0
8 9 1 0
6 7 1 0
5 6 1 0
7 8 2 0
9 5 2 0
7 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
11 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
6 18 1 0
1 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
21 33 1 0
33 34 1 0
33 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.61Molecular Weight (Monoisotopic): 471.2634AlogP: 3.29#Rotatable Bonds: 7Polar Surface Area: 93.25Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.77CX LogP: 3.26CX LogD: 0.94Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.55Np Likeness Score: -1.26
References 1. Iyamu ID, Lv W, Malik N, Mishra RK, Schiltz GE.. (2019) Discovery of a novel class of potent and selective tetrahydroindazole-based sigma-1 receptor ligands., 27 (9): [PMID:30904383 ] [10.1016/j.bmc.2019.03.030 ]