The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl 1'-((5-bromo-1-(3-hydroxypropyl)-1H-benzo[d]imidazol-2-yl)methyl)-2'-oxospiro[azetidine-3,3'-indoline]-1-carboxylate ID: ALA4539274
PubChem CID: 155549755
Max Phase: Preclinical
Molecular Formula: C25H27BrN4O4
Molecular Weight: 527.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)N1CC2(C1)C(=O)N(Cc1nc3cc(Br)ccc3n1CCCO)c1ccccc12
Standard InChI: InChI=1S/C25H27BrN4O4/c1-16(2)34-24(33)28-14-25(15-28)18-6-3-4-7-20(18)30(23(25)32)13-22-27-19-12-17(26)8-9-21(19)29(22)10-5-11-31/h3-4,6-9,12,16,31H,5,10-11,13-15H2,1-2H3
Standard InChI Key: SEZMSLPGEQDQPQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
25.0258 -6.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4303 -5.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7204 -5.1570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3159 -5.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8658 -7.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8647 -8.7066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5727 -9.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5710 -7.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2796 -7.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2844 -8.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0644 -8.9506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5418 -8.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0567 -7.6260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3589 -8.2806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7634 -7.5705 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4265 -6.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7406 -6.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5744 -7.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1814 -8.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9549 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1179 -6.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5095 -6.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6262 -6.6594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1580 -7.4787 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
23.0588 -9.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7637 -10.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7581 -10.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4630 -11.4091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7138 -4.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4183 -3.9235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0029 -3.9348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2985 -4.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5875 -3.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3050 -5.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
5 6 2 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
15 18 1 0
17 1 1 0
1 16 1 0
16 15 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
16 23 2 0
5 24 1 0
11 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
3 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.42Molecular Weight (Monoisotopic): 526.1216AlogP: 3.83#Rotatable Bonds: 6Polar Surface Area: 87.90Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.42CX LogP: 2.77CX LogD: 2.77Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -0.97
References 1. Cockerill GS, Good JAD, Mathews N.. (2019) State of the Art in Respiratory Syncytial Virus Drug Discovery and Development., 62 (7): [PMID:30411898 ] [10.1021/acs.jmedchem.8b01361 ]