2-(4-(7-(2-(2-(2-(3-tert-butylureido)ethoxy)ethoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)-3-fluorophenyl)acetamide

ID: ALA4539293

PubChem CID: 155549911

Max Phase: Preclinical

Molecular Formula: C29H33FN6O4S

Molecular Weight: 580.69

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)NC(=O)NCCOCCOc1ccccc1-c1nnc(Nc2ccc(CC(N)=O)cc2F)c2ccsc12

Standard InChI:  InChI=1S/C29H33FN6O4S/c1-29(2,3)34-28(38)32-11-12-39-13-14-40-23-7-5-4-6-19(23)25-26-20(10-15-41-26)27(36-35-25)33-22-9-8-18(16-21(22)30)17-24(31)37/h4-10,15-16H,11-14,17H2,1-3H3,(H2,31,37)(H,33,36)(H2,32,34,38)

Standard InChI Key:  BLVLCHZGMIMJLQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   19.7240  -28.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9007  -26.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6104  -25.8837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6076  -25.0610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8989  -24.6558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1927  -25.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1939  -25.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4177  -24.8141    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.9367  -25.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4157  -26.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8938  -23.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6012  -23.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5978  -22.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8877  -22.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1795  -22.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1864  -23.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9005  -27.1103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6081  -27.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6038  -28.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3106  -28.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0194  -28.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0169  -27.5133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3096  -27.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4348  -28.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1429  -28.7410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4339  -27.5160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8949  -28.7410    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.3104  -23.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0166  -23.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7258  -23.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4320  -23.4225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1412  -23.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8474  -23.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5566  -23.8235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2629  -23.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9720  -23.8184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2599  -22.5952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6783  -23.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3874  -23.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6753  -22.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3825  -22.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  1  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 19 27  1  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
 38 39  1  0
 38 40  1  0
 38 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539293

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.69Molecular Weight (Monoisotopic): 580.2268AlogP: 4.76#Rotatable Bonds: 12
Polar Surface Area: 140.49Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.93CX Basic pKa: 1.81CX LogP: 3.45CX LogD: 3.45
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.18Np Likeness Score: -1.78

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source