(R)-1-(2-((R)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-ylamino)-2-oxoethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-aminium

ID: ALA4539295

PubChem CID: 155549913

Max Phase: Preclinical

Molecular Formula: C24H26N6O3

Molecular Weight: 446.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](N)Cc1c[nH]c2ccccc12

Standard InChI:  InChI=1S/C24H26N6O3/c25-18(9-14-11-27-19-7-3-1-5-16(14)19)24(33)29-13-22(31)30-21(23(26)32)10-15-12-28-20-8-4-2-6-17(15)20/h1-8,11-12,18,21,27-28H,9-10,13,25H2,(H2,26,32)(H,29,33)(H,30,31)/t18-,21-/m1/s1

Standard InChI Key:  GXYYCHWYNYGLEG-WIYYLYMNSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.1733   -9.5735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1733  -10.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7509  -10.3948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4600  -10.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8823  -10.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3399  -10.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5914  -10.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8861  -10.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6806   -9.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4834   -9.4174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7428   -8.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1993   -8.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3965   -8.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1371   -8.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4600  -11.6247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7509  -12.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0419  -10.8034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0419  -11.6247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3328  -12.0333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3328  -12.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6196  -14.0845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6196  -13.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0419  -13.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3720  -14.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0419  -14.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6204  -15.3384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6949  -14.5671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4376  -15.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9852  -15.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7901  -15.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0433  -15.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4977  -14.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9105  -12.8546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4 15  1  0
 18 19  1  0
 22 33  1  0
  2  1  1  6
  2  4  1  0
  4  3  2  0
  2  5  1  0
  5  7  1  0
  6  7  2  0
  7  9  1  0
  8  6  1  0
 10  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  1  0
 16 18  1  0
 18 17  2  0
 20 19  1  6
 20 22  1  0
 22 21  2  0
 20 23  1  0
 23 25  1  0
 24 25  2  0
 25 27  1  0
 26 24  1  0
 28 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539295

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 reverse transcriptase (18245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.2066AlogP: 0.85#Rotatable Bonds: 9
Polar Surface Area: 158.89Molecular Species: NEUTRALHBA: 4HBD: 6
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.43CX Basic pKa: 7.66CX LogP: 0.48CX LogD: 0.03
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -0.23

References

1. Jain N, Friedman SH..  (2019)  Multiple weak intercalation as a strategy for the inhibition of polymerases.,  29  (3): [PMID:30579791] [10.1016/j.bmcl.2018.12.027]

Source