The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(2-((R)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-ylamino)-2-oxoethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-aminium ID: ALA4539295
PubChem CID: 155549913
Max Phase: Preclinical
Molecular Formula: C24H26N6O3
Molecular Weight: 446.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@H](N)Cc1c[nH]c2ccccc12
Standard InChI: InChI=1S/C24H26N6O3/c25-18(9-14-11-27-19-7-3-1-5-16(14)19)24(33)29-13-22(31)30-21(23(26)32)10-15-12-28-20-8-4-2-6-17(15)20/h1-8,11-12,18,21,27-28H,9-10,13,25H2,(H2,26,32)(H,29,33)(H,30,31)/t18-,21-/m1/s1
Standard InChI Key: GXYYCHWYNYGLEG-WIYYLYMNSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.1733 -9.5735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1733 -10.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7509 -10.3948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4600 -10.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8823 -10.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3399 -10.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5914 -10.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8861 -10.1292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6806 -9.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4834 -9.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7428 -8.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1993 -8.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3965 -8.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1371 -8.9621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4600 -11.6247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7509 -12.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0419 -10.8034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0419 -11.6247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3328 -12.0333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3328 -12.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6196 -14.0845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6196 -13.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0419 -13.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3720 -14.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0419 -14.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6204 -15.3384 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6949 -14.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4376 -15.3463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9852 -15.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7901 -15.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0433 -15.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4977 -14.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9105 -12.8546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4 15 1 0
18 19 1 0
22 33 1 0
2 1 1 6
2 4 1 0
4 3 2 0
2 5 1 0
5 7 1 0
6 7 2 0
7 9 1 0
8 6 1 0
10 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 1 0
16 18 1 0
18 17 2 0
20 19 1 6
20 22 1 0
22 21 2 0
20 23 1 0
23 25 1 0
24 25 2 0
25 27 1 0
26 24 1 0
28 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.2066AlogP: 0.85#Rotatable Bonds: 9Polar Surface Area: 158.89Molecular Species: NEUTRALHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.43CX Basic pKa: 7.66CX LogP: 0.48CX LogD: 0.03Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -0.23