(S)-3-(4-methoxyphenyl)-N-((S)-1-((R)-2-methyloxiran-2-yl)-1-oxo-3-(4-(trifluoromethyl)cyclohexyl)propan-2-yl)-2-((S)-2-(2-morpholinoacetamido)propanamido)propanamide

ID: ALA4539341

PubChem CID: 155550143

Max Phase: Preclinical

Molecular Formula: C32H45F3N4O7

Molecular Weight: 654.73

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C[C@H](NC(=O)[C@H](C)NC(=O)CN2CCOCC2)C(=O)N[C@@H](CC2CCC(C(F)(F)F)CC2)C(=O)[C@@]2(C)CO2)cc1

Standard InChI:  InChI=1S/C32H45F3N4O7/c1-20(36-27(40)18-39-12-14-45-15-13-39)29(42)38-26(17-22-6-10-24(44-3)11-7-22)30(43)37-25(28(41)31(2)19-46-31)16-21-4-8-23(9-5-21)32(33,34)35/h6-7,10-11,20-21,23,25-26H,4-5,8-9,12-19H2,1-3H3,(H,36,40)(H,37,43)(H,38,42)/t20-,21?,23?,25-,26-,31+/m0/s1

Standard InChI Key:  SEXRELDEXBUNHY-WNLCDPGCSA-N

Molfile:  

 
     RDKit          2D

 46 49  0  0  0  0  0  0  0  0999 V2000
   38.5483   -3.4215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9610   -4.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3695   -3.4190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1771   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8848   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5925   -4.5441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8848   -3.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3002   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0079   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3002   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0079   -5.3613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7156   -4.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4233   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1310   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4233   -5.3613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8388   -4.5441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1310   -3.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5465   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2542   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2542   -5.3613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.6696   -4.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4694   -4.1355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4737   -3.3173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7701   -2.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0600   -3.3140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0580   -4.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7662   -4.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1310   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1270   -6.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8339   -6.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5426   -6.5880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5399   -5.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8325   -5.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2508   -6.9956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.2519   -7.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5465   -3.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9314   -2.7091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1576   -1.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5470   -1.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7105   -1.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4879   -2.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1019   -2.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0969   -0.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5394   -0.3251    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.1880    0.0184    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.1968   -0.9742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  1  3  1  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  8  9  1  0
  8 10  1  1
  9 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  6
 14 16  1  0
 14 17  2  0
 16 18  1  0
 18 19  1  0
 19  2  1  0
 19 20  2  0
  2 21  1  6
  4 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 15 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34 35  1  0
 18 36  1  1
 36 37  1  0
 37 38  1  0
 37 42  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 43 44  1  0
 43 45  1  0
 43 46  1  0
 40 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539341

    ---

Associated Targets(Human)

PSMB10 Tchem Proteasome subunit beta type-10 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB2 Tclin Proteasome Macropain subunit (1025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 654.73Molecular Weight (Monoisotopic): 654.3240AlogP: 2.16#Rotatable Bonds: 14
Polar Surface Area: 138.60Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.78CX Basic pKa: 5.04CX LogP: 2.66CX LogD: 2.65
Aromatic Rings: 1Heavy Atoms: 46QED Weighted: 0.26Np Likeness Score: -0.47

References

1. Xin BT, Huber EM, de Bruin G, Heinemeyer W, Maurits E, Espinal C, Du Y, Janssens M, Weyburne ES, Kisselev AF, Florea BI, Driessen C, van der Marel GA, Groll M, Overkleeft HS..  (2019)  Structure-Based Design of Inhibitors Selective for Human Proteasome β2c or β2i Subunits.,  62  (3): [PMID:30657666] [10.1021/acs.jmedchem.8b01884]

Source