The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(6,7-dimethoxyquinolin-4-yloxy)-2-fluorophenyl)-2-methylbenzenesulfonamide ID: ALA4539431
PubChem CID: 44253624
Max Phase: Preclinical
Molecular Formula: C24H21FN2O5S
Molecular Weight: 468.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nccc(Oc3ccc(NS(=O)(=O)c4ccccc4C)c(F)c3)c2cc1OC
Standard InChI: InChI=1S/C24H21FN2O5S/c1-15-6-4-5-7-24(15)33(28,29)27-19-9-8-16(12-18(19)25)32-21-10-11-26-20-14-23(31-3)22(30-2)13-17(20)21/h4-14,27H,1-3H3
Standard InChI Key: VBVGXEKUXRVANA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
19.0389 -3.9044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6344 -3.1986 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.2255 -3.9018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9952 -5.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9941 -6.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7021 -6.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7003 -5.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2860 -6.9025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2874 -5.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5787 -6.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5798 -5.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4090 -5.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4097 -6.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1183 -6.8974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8265 -6.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8218 -5.6644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1127 -5.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1083 -4.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8139 -4.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5192 -4.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2242 -4.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2203 -3.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5055 -2.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8033 -3.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4983 -1.9882 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.9253 -2.7968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3407 -2.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0479 -3.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7537 -2.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7511 -1.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0369 -1.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3341 -1.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6232 -1.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 13 2 0
12 7 2 0
7 4 1 0
5 8 1 0
4 9 1 0
8 10 1 0
9 11 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
23 25 1 0
22 26 1 0
26 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1155AlogP: 5.29#Rotatable Bonds: 7Polar Surface Area: 86.75Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.66CX Basic pKa: 5.89CX LogP: 4.46CX LogD: 4.43Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.38
References 1. Szabadkai I, Torka R, Garamvölgyi R, Baska F, Gyulavári P, Boros S, Illyés E, Choidas A, Ullrich A, Őrfi L.. (2018) Discovery of N-[4-(Quinolin-4-yloxy)phenyl]benzenesulfonamides as Novel AXL Kinase Inhibitors., 61 (14): [PMID:29928803 ] [10.1021/acs.jmedchem.8b00672 ]