The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-bromo-2-fluorobenzyloxy)-2-nitrobenzoyl)-3-hydroxy-5-methylcyclohex-2-en-1-one ID: ALA4539445
PubChem CID: 155550052
Max Phase: Preclinical
Molecular Formula: C21H17BrFNO6
Molecular Weight: 478.27
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1CC(=O)C(C(=O)c2cccc(OCc3ccc(Br)cc3F)c2[N+](=O)[O-])=C(O)C1
Standard InChI: InChI=1S/C21H17BrFNO6/c1-11-7-16(25)19(17(26)8-11)21(27)14-3-2-4-18(20(14)24(28)29)30-10-12-5-6-13(22)9-15(12)23/h2-6,9,11,25H,7-8,10H2,1H3
Standard InChI Key: YEZZWVHFOGNZSB-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
21.9156 -10.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7537 -9.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7526 -10.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4606 -10.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1703 -10.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1674 -9.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4588 -9.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0459 -9.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0457 -8.2752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3383 -9.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6286 -9.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9231 -9.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6267 -10.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3384 -10.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6320 -8.2685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0453 -10.7222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8736 -9.0860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5828 -9.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2890 -9.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9967 -9.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7024 -9.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6997 -8.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9855 -7.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2827 -8.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4564 -8.2748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1629 -7.8641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7474 -7.8683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4053 -7.8491 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
28.9977 -10.3072 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.2054 -10.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
10 14 1 0
11 12 1 0
12 1 1 0
1 13 1 0
13 14 1 0
11 15 1 0
14 16 2 0
6 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
7 25 1 0
25 26 1 0
25 27 2 0
22 28 1 0
20 29 1 0
1 30 1 0
M CHG 2 25 1 26 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.27Molecular Weight (Monoisotopic): 477.0223AlogP: 5.07#Rotatable Bonds: 6Polar Surface Area: 106.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.92CX Basic pKa: ┄CX LogP: 4.71CX LogD: 1.50Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.27Np Likeness Score: -0.64
References 1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF.. (2019) Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors., 166 [PMID:30684868 ] [10.1016/j.ejmech.2019.01.032 ]