2-(3-(4-chlorobenzyloxy)benzoyl)-3-hydroxycyclohex-2-en-1-one

ID: ALA4539505

PubChem CID: 155549825

Max Phase: Preclinical

Molecular Formula: C20H17ClO4

Molecular Weight: 356.80

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC(O)=C1C(=O)c1cccc(OCc2ccc(Cl)cc2)c1

Standard InChI:  InChI=1S/C20H17ClO4/c21-15-9-7-13(8-10-15)12-25-16-4-1-3-14(11-16)20(24)19-17(22)5-2-6-18(19)23/h1,3-4,7-11,22H,2,5-6,12H2

Standard InChI Key:  MLNKWXZSVDPACO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   31.6751   -3.8176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6739   -4.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3820   -5.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0916   -4.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0888   -3.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3802   -3.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9673   -3.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9671   -2.5920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2596   -3.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5500   -3.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8445   -3.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8405   -4.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5481   -5.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2598   -4.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5533   -2.5853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9667   -5.0390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7950   -3.4028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5042   -3.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2104   -3.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9180   -3.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6237   -3.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6211   -2.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9069   -2.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2041   -2.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3267   -2.1659    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 15  1  0
 14 16  2  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539505

    ---

Associated Targets(Human)

HPD Tclin 4-hydroxyphenylpyruvate dioxygenase (117 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.80Molecular Weight (Monoisotopic): 356.0815AlogP: 4.67#Rotatable Bonds: 5
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.49CX Basic pKa: CX LogP: 4.17CX LogD: 1.35
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.62Np Likeness Score: -0.34

References

1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF..  (2019)  Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors.,  166  [PMID:30684868] [10.1016/j.ejmech.2019.01.032]

Source