1-(4-((5-chloro-4-((4-methoxyphenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea

ID: ALA4539702

PubChem CID: 155549572

Max Phase: Preclinical

Molecular Formula: C25H24ClN7O3

Molecular Weight: 505.97

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Nc2nc(Nc3ccc(NC(=O)NCc4cccnc4)cc3OC)ncc2Cl)cc1

Standard InChI:  InChI=1S/C25H24ClN7O3/c1-35-19-8-5-17(6-9-19)30-23-20(26)15-28-24(33-23)32-21-10-7-18(12-22(21)36-2)31-25(34)29-14-16-4-3-11-27-13-16/h3-13,15H,14H2,1-2H3,(H2,29,31,34)(H2,28,30,32,33)

Standard InChI Key:  WXRXMNVZOIFOQH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   32.3065  -27.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3054  -28.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0134  -28.6663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7231  -28.2568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7203  -27.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0116  -27.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4264  -27.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1357  -27.4288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8418  -27.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5511  -27.4235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.2572  -27.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9625  -27.4199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6682  -27.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6655  -26.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9513  -25.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2486  -26.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8387  -26.2004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3772  -27.4156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3799  -28.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3711  -25.7791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0809  -26.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0809  -27.0014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7899  -27.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4965  -26.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4897  -26.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7802  -25.7715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.2068  -27.3981    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   42.1938  -25.7580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.9050  -26.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9068  -26.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6172  -27.3791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3223  -26.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3126  -26.1429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6017  -25.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0341  -27.3658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.0422  -28.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  2  0
 13 18  1  0
 18 19  1  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539702

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KARPAS-299 (888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.97Molecular Weight (Monoisotopic): 505.1629AlogP: 5.35#Rotatable Bonds: 9
Polar Surface Area: 122.32Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.76CX Basic pKa: 4.82CX LogP: 4.13CX LogD: 4.13
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.71

References

1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y..  (2019)  Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors.,  178  [PMID:31177074] [10.1016/j.ejmech.2019.05.060]

Source