The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((4-methoxyphenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(pyridin-3-ylmethyl)urea ID: ALA4539702
PubChem CID: 155549572
Max Phase: Preclinical
Molecular Formula: C25H24ClN7O3
Molecular Weight: 505.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Nc2nc(Nc3ccc(NC(=O)NCc4cccnc4)cc3OC)ncc2Cl)cc1
Standard InChI: InChI=1S/C25H24ClN7O3/c1-35-19-8-5-17(6-9-19)30-23-20(26)15-28-24(33-23)32-21-10-7-18(12-22(21)36-2)31-25(34)29-14-16-4-3-11-27-13-16/h3-13,15H,14H2,1-2H3,(H2,29,31,34)(H2,28,30,32,33)
Standard InChI Key: WXRXMNVZOIFOQH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
32.3065 -27.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3054 -28.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0134 -28.6663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7231 -28.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7203 -27.4342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0116 -27.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4264 -27.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1357 -27.4288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8418 -27.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5511 -27.4235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2572 -27.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9625 -27.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6682 -27.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6655 -26.1913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9513 -25.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2486 -26.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8387 -26.2004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3772 -27.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3799 -28.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3711 -25.7791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0809 -26.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0809 -27.0014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7899 -27.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4965 -26.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4897 -26.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7802 -25.7715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.2068 -27.3981 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
42.1938 -25.7580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9050 -26.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9068 -26.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6172 -27.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3223 -26.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3126 -26.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6017 -25.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0341 -27.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.0422 -28.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 2 0
13 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
25 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.97Molecular Weight (Monoisotopic): 505.1629AlogP: 5.35#Rotatable Bonds: 9Polar Surface Area: 122.32Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.76CX Basic pKa: 4.82CX LogP: 4.13CX LogD: 4.13Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.71
References 1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y.. (2019) Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors., 178 [PMID:31177074 ] [10.1016/j.ejmech.2019.05.060 ]