The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-Chlorophenyl)-N-(2-methyl-5-((4-methylpentyl)carbamoyl)phenyl)thiophene-2-carboxamide ID: ALA4539759
PubChem CID: 155550010
Max Phase: Preclinical
Molecular Formula: C25H27ClN2O2S
Molecular Weight: 455.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)NCCCC(C)C)cc1NC(=O)c1ccc(-c2ccccc2Cl)s1
Standard InChI: InChI=1S/C25H27ClN2O2S/c1-16(2)7-6-14-27-24(29)18-11-10-17(3)21(15-18)28-25(30)23-13-12-22(31-23)19-8-4-5-9-20(19)26/h4-5,8-13,15-16H,6-7,14H2,1-3H3,(H,27,29)(H,28,30)
Standard InChI Key: WNKMMVGYTASSLQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.3732 -10.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1795 -10.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2571 -9.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4955 -9.3343 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.9557 -9.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1327 -9.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7879 -9.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9657 -9.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4902 -9.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8385 -10.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6596 -10.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2681 -8.4572 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.9688 -9.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6896 -9.6450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9596 -8.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4013 -9.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1197 -9.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8308 -9.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8222 -8.3852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0964 -7.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3882 -8.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5515 -9.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5602 -10.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2591 -9.1973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6694 -8.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9756 -9.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9843 -10.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7008 -10.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7095 -11.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4259 -12.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0018 -12.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
7 12 1 0
3 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 2 0
22 24 1 0
21 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.02Molecular Weight (Monoisotopic): 454.1482AlogP: 6.80#Rotatable Bonds: 8Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.97CX Basic pKa: ┄CX LogP: 6.87CX LogD: 6.87Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -1.43
References 1. Röhm S, Berger BT, Schröder M, Chaikuad A, Winkel R, Hekking KFW, Benningshof JJC, Müller G, Tesch R, Kudolo M, Forster M, Laufer S, Knapp S.. (2019) Fast Iterative Synthetic Approach toward Identification of Novel Highly Selective p38 MAP Kinase Inhibitors., 62 (23): [PMID:31702918 ] [10.1021/acs.jmedchem.9b01227 ]