3-(1H-indazol-6-yl)-4-methyl-N-(4-(4-methylpiperazin-1-yl)phenyl)benzamide

ID: ALA4539769

PubChem CID: 155550059

Max Phase: Preclinical

Molecular Formula: C26H27N5O

Molecular Weight: 425.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)cc1-c1ccc2cn[nH]c2c1

Standard InChI:  InChI=1S/C26H27N5O/c1-18-3-4-20(15-24(18)19-5-6-21-17-27-29-25(21)16-19)26(32)28-22-7-9-23(10-8-22)31-13-11-30(2)12-14-31/h3-10,15-17H,11-14H2,1-2H3,(H,27,29)(H,28,32)

Standard InChI Key:  SNXWOXRVQJRBKU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   29.4681   -5.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1778   -5.4869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1750   -4.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4664   -4.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7601   -5.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7567   -4.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9748   -4.4158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4949   -5.0820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9803   -5.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8781   -4.2543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5876   -4.6619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2933   -4.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2907   -3.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5765   -3.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8737   -3.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1634   -3.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0024   -4.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0051   -5.4748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7087   -4.2467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4178   -4.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4169   -5.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1251   -5.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8324   -5.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8271   -4.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1183   -4.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5420   -5.8702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5398   -6.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2453   -7.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9536   -6.6838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.9518   -5.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2417   -5.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6616   -7.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  3 10  1  0
 15 16  1  0
 12 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539769

    ---

Associated Targets(Human)

DDR2 Tchem Discoidin domain-containing receptor 2 (2199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.54Molecular Weight (Monoisotopic): 425.2216AlogP: 4.54#Rotatable Bonds: 4
Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.93CX Basic pKa: 7.86CX LogP: 4.50CX LogD: 3.92
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.68

References

1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B..  (2019)  Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma.,  163  [PMID:30572178] [10.1016/j.ejmech.2018.12.015]

Source