The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5,6-Diethyl-4(3H)-pyrimidone-2-yl)-4-n-propoxyphenyl)sulfonyl-L-proline ID: ALA4539785
PubChem CID: 137051684
Max Phase: Preclinical
Molecular Formula: C22H29N3O6S
Molecular Weight: 463.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCOc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)O)cc1-c1nc(CC)c(CC)c(=O)[nH]1
Standard InChI: InChI=1S/C22H29N3O6S/c1-4-12-31-19-10-9-14(32(29,30)25-11-7-8-18(25)22(27)28)13-16(19)20-23-17(6-3)15(5-2)21(26)24-20/h9-10,13,18H,4-8,11-12H2,1-3H3,(H,27,28)(H,23,24,26)/t18-/m0/s1
Standard InChI Key: LQCPQKMDKUNQLG-SFHVURJKSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
30.4589 -6.4013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8717 -5.6956 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.0541 -5.6910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0431 -2.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0420 -3.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7500 -3.6594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4597 -3.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4568 -2.4273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7482 -2.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7458 -1.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3353 -2.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3351 -1.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3339 -3.6585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6265 -3.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1645 -3.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1644 -4.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8720 -4.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5800 -4.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5761 -3.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8680 -3.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8645 -2.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5704 -2.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2799 -2.4242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9858 -2.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5810 -6.1074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6679 -6.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4698 -7.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8816 -6.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3342 -5.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5047 -4.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2821 -4.7202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8978 -4.4249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 4 1 0
9 10 2 0
4 11 1 0
11 12 1 0
5 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
7 15 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
17 2 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
29 30 1 6
30 31 1 0
30 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.56Molecular Weight (Monoisotopic): 463.1777AlogP: 2.59#Rotatable Bonds: 9Polar Surface Area: 129.66Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.76CX Basic pKa: ┄CX LogP: 2.78CX LogD: -0.81Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.58Np Likeness Score: -1.16
References 1. Wang Z, Jiang X, Zhang X, Tian G, Yang R, Wu J, Zou X, Liu Z, Yang X, Wu C, Shi J, Li J, Suo J, Wang Y, Zhang R, Xu Z, Gong X, He Y, Zhu W, Aisa HA, Jiang H, Xu Y, Shen J.. (2019) Pharmacokinetics-Driven Optimization of 4(3 H)-Pyrimidinones as Phosphodiesterase Type 5 Inhibitors Leading to TPN171, a Clinical Candidate for the Treatment of Pulmonary Arterial Hypertension., 62 (10): [PMID:31021628 ] [10.1021/acs.jmedchem.9b00123 ]