The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Cyano-N-(1-(1-(cyclopentanecarbonyl)piperidin-4-yl)-1H-indol-6-yl)benzamide ID: ALA4539792
PubChem CID: 155550145
Max Phase: Preclinical
Molecular Formula: C27H28N4O2
Molecular Weight: 440.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cccc(C(=O)Nc2ccc3ccn(C4CCN(C(=O)C5CCCC5)CC4)c3c2)c1
Standard InChI: InChI=1S/C27H28N4O2/c28-18-19-4-3-7-22(16-19)26(32)29-23-9-8-20-10-15-31(25(20)17-23)24-11-13-30(14-12-24)27(33)21-5-1-2-6-21/h3-4,7-10,15-17,21,24H,1-2,5-6,11-14H2,(H,29,32)
Standard InChI Key: QANQRVFTDKUQNM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
35.9137 -4.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9126 -5.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6206 -5.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3303 -5.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3275 -4.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6188 -4.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6164 -3.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6140 -2.6576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0386 -5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0399 -6.7446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.7457 -5.5177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4541 -5.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4507 -6.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1582 -7.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1543 -5.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8623 -5.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8693 -6.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6500 -6.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1255 -6.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6386 -5.6576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8837 -4.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7019 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0967 -4.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6779 -3.4525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8598 -3.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4606 -4.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0754 -2.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8924 -2.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6558 -2.0372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.3800 -3.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1532 -3.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1404 -2.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3593 -2.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 3 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 17 2 0
16 15 2 0
15 12 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
20 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.55Molecular Weight (Monoisotopic): 440.2212AlogP: 5.12#Rotatable Bonds: 4Polar Surface Area: 78.13Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.17CX LogD: 4.17Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.69
References 1. Tian J, Sun N, Yu M, Gu X, Xie Q, Shao L, Liu J, Liu L, Wang Y.. (2019) Discovery of N-indanyl benzamides as potent RORγt inverse agonists., 167 [PMID:30743096 ] [10.1016/j.ejmech.2019.01.082 ]