The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(2-(4-(3-(3,4,5-Trifluorophenyl)acryloyl)piperazin-1-yl)ethyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA4539838
PubChem CID: 155549834
Max Phase: Preclinical
Molecular Formula: C27H22F3N3O3
Molecular Weight: 493.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1cc(F)c(F)c(F)c1)N1CCN(CCN2C(=O)c3cccc4cccc(c34)C2=O)CC1
Standard InChI: InChI=1S/C27H22F3N3O3/c28-21-15-17(16-22(29)25(21)30)7-8-23(34)32-12-9-31(10-13-32)11-14-33-26(35)19-5-1-3-18-4-2-6-20(24(18)19)27(33)36/h1-8,15-16H,9-14H2/b8-7+
Standard InChI Key: DXQADIAEXHXFQK-BQYQJAHWSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
16.1691 -20.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1679 -21.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8742 -19.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8751 -21.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8736 -22.3906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5818 -22.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2930 -22.3891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5828 -20.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5816 -21.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2917 -21.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0075 -21.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0087 -20.3456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2941 -19.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2941 -19.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7141 -21.5814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7174 -19.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4241 -20.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1328 -19.9423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8391 -20.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5457 -19.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5519 -19.1355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8453 -18.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1326 -19.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2621 -18.7313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9673 -19.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2672 -17.9141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6775 -18.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3827 -19.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3746 -19.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0789 -20.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7902 -19.9773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7926 -19.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0877 -18.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5015 -18.7491 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4959 -20.3893 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.0735 -21.1987 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 4 1 0
8 3 2 0
3 1 1 0
9 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 10 1 0
8 9 1 0
8 13 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
11 15 2 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
31 35 1 0
30 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.49Molecular Weight (Monoisotopic): 493.1613AlogP: 3.71#Rotatable Bonds: 5Polar Surface Area: 60.93Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.22CX LogP: 3.79CX LogD: 3.76Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -0.94
References 1. Sankara Rao N, Nagesh N, Lakshma Nayak V, Sunkari S, Tokala R, Kiranmai G, Regur P, Shankaraiah N, Kamal A.. (2019) Design and synthesis of DNA-intercalative naphthalimide-benzothiazole/cinnamide derivatives: cytotoxicity evaluation and topoisomerase-IIα inhibition., 10 (1): [PMID:30774856 ] [10.1039/C8MD00395E ]