The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(1-Adamantyl-1-hydroxyiminomethyl)-3-pentylbenzo[d]thiazol-2(3H)-one ID: ALA4539849
PubChem CID: 155549880
Max Phase: Preclinical
Molecular Formula: C23H30N2O2S
Molecular Weight: 398.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCn1c(=O)sc2cc(/C(=N\O)C34CC5CC(CC(C5)C3)C4)ccc21
Standard InChI: InChI=1S/C23H30N2O2S/c1-2-3-4-7-25-19-6-5-18(11-20(19)28-22(25)26)21(24-27)23-12-15-8-16(13-23)10-17(9-15)14-23/h5-6,11,15-17,27H,2-4,7-10,12-14H2,1H3/b24-21+
Standard InChI Key: VTQGNKUZJLDWLY-DARPEHSRSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
24.5099 -27.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5087 -28.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2168 -29.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2150 -27.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9236 -27.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9284 -28.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7084 -28.9310 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.1858 -28.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7007 -27.6065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0030 -28.2611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8007 -29.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0933 -28.6860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8001 -29.9123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0169 -29.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6521 -28.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8096 -29.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3526 -28.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5593 -29.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8070 -28.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3583 -27.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6476 -27.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1032 -27.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6949 -26.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3997 -26.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1103 -26.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8151 -26.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5257 -26.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5075 -30.3215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
2 11 1 0
11 12 1 0
11 13 2 0
14 15 1 0
14 16 1 0
15 17 1 0
16 18 1 0
17 12 1 0
18 12 1 0
19 20 1 0
16 19 1 0
15 21 1 0
12 22 1 0
22 20 1 0
20 21 1 0
9 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
13 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.57Molecular Weight (Monoisotopic): 398.2028AlogP: 5.65#Rotatable Bonds: 6Polar Surface Area: 54.59Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.48CX Basic pKa: 2.14CX LogP: 5.79CX LogD: 4.84Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.30Np Likeness Score: -0.89
References 1. Leleu-Chavain N, Baudelet D, Heloire VM, Rocha DE, Renault N, Barczyk A, Djouina M, Body-Malapel M, Carato P, Millet R.. (2019) Benzo[d]thiazol-2(3H)-ones as new potent selective CB2 agonists with anti-inflammatory properties., 165 [PMID:30583970 ] [10.1016/j.ejmech.2018.12.008 ]