2-Cyclohexyl-N-(1-isopropylpiperidin-4-yl)-7-methoxy-8-(3-(pyrrolidin-1-yl)propoxy)-2,3-dihydro-1H-benzo[e][1,4]-diazepin-5-amine

ID: ALA4539914

PubChem CID: 155550222

Max Phase: Preclinical

Molecular Formula: C31H51N5O2

Molecular Weight: 525.78

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OCCCN1CCCC1)NC(C1CCCCC1)CN=C2NC1CCN(C(C)C)CC1

Standard InChI:  InChI=1S/C31H51N5O2/c1-23(2)36-17-12-25(13-18-36)33-31-26-20-29(37-3)30(38-19-9-16-35-14-7-8-15-35)21-27(26)34-28(22-32-31)24-10-5-4-6-11-24/h20-21,23-25,28,34H,4-19,22H2,1-3H3,(H,32,33)

Standard InChI Key:  KEEFTCVVUFHDAV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    7.0107  -22.5140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0096  -23.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7176  -23.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7159  -22.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3016  -23.7416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5942  -23.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3029  -22.1056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3027  -21.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8862  -23.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1788  -23.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4707  -23.7393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7268  -23.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1795  -24.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5875  -24.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3869  -24.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4252  -23.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4206  -22.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0588  -21.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0723  -23.8369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8598  -22.1661    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8719  -23.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2194  -22.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8682  -21.1995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4611  -20.6371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2435  -20.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8352  -20.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6486  -19.5184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8648  -19.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2675  -19.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2436  -18.9582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0262  -19.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0560  -18.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3881  -24.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0928  -25.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6053  -25.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4130  -25.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7057  -24.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1906  -24.1426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 16  2  0
 17  4  2  0
  4  1  1  0
  2  5  1  0
  5  6  1  0
  1  7  1  0
  7  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 18 20  2  0
 19 21  1  0
 20 22  1  0
 21 22  1  0
 18 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
 30 31  1  0
 30 32  1  0
 21 33  1  0
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4539914

    ---

Associated Targets(Human)

EHMT2 Tchem Histone-lysine N-methyltransferase, H3 lysine-9 specific 3 (93046 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.78Molecular Weight (Monoisotopic): 525.4043AlogP: 5.14#Rotatable Bonds: 9
Polar Surface Area: 61.36Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.93CX LogP: 3.84CX LogD: -2.04
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.44Np Likeness Score: -0.56

References

1. Milite C, Feoli A, Horton JR, Rescigno D, Cipriano A, Pisapia V, Viviano M, Pepe G, Amendola G, Novellino E, Cosconati S, Cheng X, Castellano S, Sbardella G..  (2019)  Discovery of a Novel Chemotype of Histone Lysine Methyltransferase EHMT1/2 (GLP/G9a) Inhibitors: Rational Design, Synthesis, Biological Evaluation, and Co-crystal Structure.,  62  (5): [PMID:30753076] [10.1021/acs.jmedchem.8b02008]

Source