The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Cyclohexyl-N-(1-isopropylpiperidin-4-yl)-7-methoxy-8-(3-(pyrrolidin-1-yl)propoxy)-2,3-dihydro-1H-benzo[e][1,4]-diazepin-5-amine ID: ALA4539914
PubChem CID: 155550222
Max Phase: Preclinical
Molecular Formula: C31H51N5O2
Molecular Weight: 525.78
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OCCCN1CCCC1)NC(C1CCCCC1)CN=C2NC1CCN(C(C)C)CC1
Standard InChI: InChI=1S/C31H51N5O2/c1-23(2)36-17-12-25(13-18-36)33-31-26-20-29(37-3)30(38-19-9-16-35-14-7-8-15-35)21-27(26)34-28(22-32-31)24-10-5-4-6-11-24/h20-21,23-25,28,34H,4-19,22H2,1-3H3,(H,32,33)
Standard InChI Key: KEEFTCVVUFHDAV-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
7.0107 -22.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0096 -23.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7176 -23.7425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7159 -22.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3016 -23.7416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5942 -23.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3029 -22.1056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3027 -21.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8862 -23.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1788 -23.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4707 -23.7393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7268 -23.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1795 -24.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5875 -24.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3869 -24.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4252 -23.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4206 -22.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0588 -21.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0723 -23.8369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8598 -22.1661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8719 -23.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2194 -22.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8682 -21.1995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4611 -20.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2435 -20.8728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8352 -20.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6486 -19.5184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8648 -19.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2675 -19.8455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2436 -18.9582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0262 -19.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0560 -18.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3881 -24.2801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0928 -25.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6053 -25.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4130 -25.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7057 -24.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1906 -24.1426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 16 2 0
17 4 2 0
4 1 1 0
2 5 1 0
5 6 1 0
1 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
16 17 1 0
17 18 1 0
16 19 1 0
18 20 2 0
19 21 1 0
20 22 1 0
21 22 1 0
18 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
21 33 1 0
33 34 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.78Molecular Weight (Monoisotopic): 525.4043AlogP: 5.14#Rotatable Bonds: 9Polar Surface Area: 61.36Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.93CX LogP: 3.84CX LogD: -2.04Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.44Np Likeness Score: -0.56
References 1. Milite C, Feoli A, Horton JR, Rescigno D, Cipriano A, Pisapia V, Viviano M, Pepe G, Amendola G, Novellino E, Cosconati S, Cheng X, Castellano S, Sbardella G.. (2019) Discovery of a Novel Chemotype of Histone Lysine Methyltransferase EHMT1/2 (GLP/G9a) Inhibitors: Rational Design, Synthesis, Biological Evaluation, and Co-crystal Structure., 62 (5): [PMID:30753076 ] [10.1021/acs.jmedchem.8b02008 ]